| 24-epibrassinolide |

Last updated: 03/02/2026
|
 |
(Also known as: epibrassinolide) |
| 24-epibrassinolide is a naturally occurring plant hormone. It has a low aqueous solubility but is more soluble in organic solvents. It has a low volatility tends to be moderately persistent in soil systems. It may be more persistent in water depending upon conditions. 24-epibrassinolide is moderately toxic to most aquatic species. This substance has a low oral mammalian toxicity. |
The following Pesticide Hazard Tricolour (PHT) alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement. The alerts for Highly Hazardous Pesticides (HHPs) are based on applying the FAO/WHO (Type 1) and the PAN (Type II) criteria to PPDB data. Further details on the HHP indicators are given in the tables below. Neither the PHT nor the HHP hazard alerts take account of usage patterns or exposure, thus they do not represent risk.
| PHT: Environmental fate |
PHT: Ecotoxicity |
PHT: Human health |
Highly Hazardous Pesticide |
|
|
|
  |
|
|
|
|
|
An activator that enhances the plants ability to protect against abiotic stresses and to improve plant health. Although it is effective against some fungal infections it has no direct fungicidal or antagonistic effects. |
|
|
Grey mold; Downy mildew; Bottom rot; Leaf spot; Stress |
|
|
Wine and table grapes; Leafy vegetables e.g. endive, chicory, spinach; Pumpkin; Lettuce; Cucumber; Sugarbeet |
|
|
Effectiveness demonstrated in plant trials. Disease severity and incidence tend to be reduced rather than cured. Studies have shown that 24-epibrassinolide has a significant effect on seed germination, seedling growth, and plant development by interacting with specific receptors in plants and activating signalling pathways that regulate growth and development processes. |
|
|
- |
|
|
- |
|
|
Not approved |
|
|
Not applicable |
|
|
No UK approval for use as a plant protection agent |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Approved |
|
|
Austria |
|
|
31/03/2036 |
|
|
No |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
|   |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
|
24-epibrassinolide exhibits stereoisomerism, specifically epimerism, which is a subtype of diastereomerism. It is an epimer of brassinolide, differing only in the configuration at the C-24 carbon atom in the side chain of the steroidal structure. While brassinolide has the hydroxyl group at C-24 in one spatial orientation, 24-epibrassinolide has it in the opposite configuration. |
|
|
C₂₈H₄₈O₆ |
|
|
CC(C)C(C)C(C(C(C)C1CCC2C1(CCC3C2COC(=O)C4C3(CC(C(C4)O)O)C)C)O)O |
|
|
- |
|
|
IXVMHGVQKLDRKH-UHFFFAOYSA-N |
|
|
InChI=1S/C28H48O6/c1-14(2)15(3)24(31)25(32)16(4)18-7-8-19-17-13-34-26(33)21-11-22(29)23(30)12-28(21,6)20(17)9-10-27(18,19)5/h14-25,29-32H,7-13H2,1-6H3 |
|
|
Yes |
| Cambridge Crystallographic Data Centre diagrams |
|
|
| Common Name |
Relationship |
Link |
| 24-epibrassinolide |
- |
 |
|
|
Fungicide; Other substance |
|
|
Elicitor; Plant activator; Biostimulant - improved abiotic stress resiliance & enhanced growth |
|
|
Plant hormone; Plant-derived substance |
|
|
900 g kg⁻¹ |
|
|
EU dossier 2018: None declared |
|
|
Natural |
|
|
An elicitor of the plant’s self-defence mechanisms against fungal diseases |
|
|
It was first discovered in rape (Brassica napus) pollen and has since been identified in many other plant tissues including Brassica juncea and Camellia sinensis. |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
78821-43-9 |
|
|
639-387-1 |
|
|
None allocated |
|
|
- |
|
|
- |
|
|
480.68 |
|
|
(22R,23R,24R)-2a,3a,22,23-tetrahydroxy-24-methyl-ß-homo-7-oxa-5-cholestan-6-one |
|
|
(22R,23R,24R)-2α,3α,22,23-tetrahydroxy-24-methyl-β-homo-7-oxa-5-cholestan-6-one |
|
|
24-epibrassinolide |
|
|
| UK Poisons List Order 1972 |
Rotterdam Convention |
Montreal Protocol |
|
|
|
| Stockholm Convention |
OSPAR |
EU Water Framework Directive |
|
|
|
|
|
|
- |
|
|
- |
|
|
|
- |
|
|
- |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
- |
|
|
White to cream coloured powdery solid |
|
|
|
|
|
|
|
|
Current |
|
|
1979, discovered |
|
|
- Suntton
- Jinan Ponder Chemical Co. Ltd.
- Sichuan Xinlanyue Biotechnology
|
|
|
|
|
|
Available in a range of formulations including liquids, powders and microencapsulated forms |
|
|
24-epibrassinolide can be produced commercially via two main processes. Chemical synthesis is the usual approach. This often begins with ergosterol, a sterol found in fungi. Methyl sulfonylation of ergosterol followed by hydrolysis and oxidation forms intermediate ketones. Ring modifications build the brassinosteroid skeleton. Stereoselective reactions follow to ensure correct configuration at multiple chiral centres. Finally, the material is purified using chromatography and crystallisation. Alternatively, the substance can be produced by microbial biotransformation. Uses genetically engineered microbes (e.g., Saccharomyces cerevisiae) to convert sterols into brassinosteroids. |
|
|
While it is marketed as a low-risk substance, the environmental impact of 24-epibrassinolide production, especially in terms of GHGs, remains unclear. Generally, fungicide production creates 11 to 30 kg of CO₂e per kg of substance produced but the accuracy of this data for 24-epibrassinolide is unknown. |
|
|
|
|
|
|
|
|
|
|
3.8 |
at pH 4.5 |
Low |
|
|
28700 |
Methanol |
- |
| 3.1 |
n-Heptane |
- |
| 5500 |
Ethyl acetate |
- |
| 18000 |
Acetone |
- |
|
|
254.6 |
|
- |
|
|
>400 |
|
- |
|
|
>400 |
|
- |
|
|
- |
- |
- |
|
|
|
1.00 X 1002 |
Calculated |
- |
|
|
2.0 |
at 30 °C |
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
No dissociation |
|
- |
| - |
|
|
1.9 X 10-12 |
Estimated |
Low volatility |
|
|
2.40 X 10-13 |
|
Non-volatile |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
pH 5.5: 205nm=183, 215nm=91.0 pH 0.6: 200nm=245 pH 13.4: 219nm=67 |
|
- |
|
|
68 |
|
- |
|
|
|
|
|
|
|
Nor readily biodegradable |
|
|
|
34.4 |
|
Moderately persistent |
|
|
34.4 |
|
Moderately persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
EU dossier 2018: Dark aerobic conditions normalised Lab DT₅₀ range 22.17-69.55 days, Soils=3 |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
Stable |
|
Stable |
|
|
- |
|
|
|
19.6 |
at 25 °C |
Non-persistent |
|
|
pH sensitive: 24.1 days at pH 5, 16.4 days at pH 9, all at 25 °C |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
|
- |
| Soil adsorption and mobility |
|
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
> 5000 |
Rat |
Low |
|
|
300 |
Rat 90-day |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
> 10 |
Apis mellifera solubility limit |
Moderate |
|
|
> 92.2 |
Apis mellifera |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 0.69 |
Aphidius rhopalosiphi |
Moderate |
|
|
0.28 |
Typhlodromus pyri |
Moderate |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
- |
- |
- |
|
|
- |
|
|
|
|
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 5.0 |
Danio rerio |
Moderate |
|
|
> 2.86 |
Daphnia magna |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
| Regulatory Threshold Levels (RTLs) |
|
Note: These RTLs have been calculated using the regulatory approach used in the European Union and based on ecotoxocity values in the PPDB.
|
|
|
|
|
|
60 |
Worst case of acute and chronic mammals |
|
|
No data |
No data for acute and chronic birds |
|
|
No data |
No data for acute and chronic earthworms |
|
|
No data |
No data for non-target plants vegetative vigour and seedling emergence |
|
|
0.2 |
Worst case of contact and oral honeybees |
|
|
0.14 |
Worst case of parasitic wasps and predatory mites |
|
|
No data |
No data for temperate acute and chronic fish |
|
|
0.0286 |
Worst case of temperate acute and chronic aquatic invertebrates |
|
|
No data |
No data for free-floating plants, rooted plants, acute and chronic algae |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
> 5000 |
Rat |
Low |
|
|
300 |
Rat 90-day |
Low |
|
|
- |
- |
- |
|
|
> 2000 |
Rat |
- |
|
|
> 1.08 |
Rat 4 hr |
- |
|
|
- |
- |
- |
|
|
None allocated |
|
- |
|
|
None allocated |
|
- |
|
|
None allocated |
|
- |
|
|
None allocated |
|
- |
|
|
0.01 |
|
- |
|
|
- |
- |
- |
|
|
|
As the substance displays no biologically or toxicologically relevant hazard risks are consider negligible |
|
|
As the substance displays no biologically or toxicologically relevant hazard risks are consider negligible |
|
|
Rapidly distributed and excreted mainly via urine and faeces |
|
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
XNo, known not to cause a problem |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
| Eye irritant |
Phototoxicant |
  |
XNo, known not to cause a problem |
No data found |
  |
|
|
|
Decrease in food consumption and loss of body weight may occur if ingested |
|
|
|
|
|
Not explosive or oxidising Not expected to auto-ignite; Not highly flammable |
|
|
Environment: H413 |
|
|
Not listed (Not listed) |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
24-epibrassinolide |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
| Record last updated: |
03/02/2026 |
| Contact: |
aeru@herts.ac.uk |
| Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |
© Copyright University of Hertfordshire, 2006-2026. All Rights Reserved
Your use of this website and its various databases is subject to the terms detailed in the University of Hertfordshire’s copyright and IPR statement that can be found at
https://www.herts.ac.uk/about-us/legal.
In addition, your use of this website and its various databases is subject to the terms of this additional Copyright Statement and the database
Conditions of use document.
Unless explicitly stated otherwise, the content of this website and databases are owned and controlled by the University of Hertfordshire. Site content, including its selection and arrangement, is owned by the University of Hertfordshire and is protected by copyright and other laws.
Except as otherwise expressly permitted under copyright law or within the database Conditions of Use document, the content of this site may not be copied, reproduced, republished, downloaded, posted, broadcast or transmitted in any way without first obtaining the University of Hertfordshire’s written permission.
By using our databases the user is deemed to have agreed to comply with all of the terms and conditions as described above and within all relevant documentation.