Onion oil |

Last updated: 30/04/2025
|
 |
(Also known as: Oil of Allium cepa L.; Allium cepa L. bulb extract) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
  |
  |
|
|
Oil or aqueous extract derived from Allium cepa L. used as an insect repellent or fungicide |
|
Carrot root fly (psila rosae); Early blight; Tomato late blight; Grey mold; Common insect pests |
|
Carrots, Celeriac, Parsnips, Parsley; Potatoes, Tomatoe; Cucumber |
|
- |
|
- |
|
Current |
|
- |
|
Class: Magnoliopsida; Order: Asparagales; Family: Amaryllidaceae |
EC Regulation 1107/2009 (repealing 91/414) |
|
Approved |
|
- |
|
Open ended |
|
No |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
✓ |
✓ |
  |
  |
  |
  |
  |
  |
  |
|
|
- |
|
C₇H₁₆ClNO₂ |
|
CCC(C)C(C(=O)OC)N.Cl |
|
CC[C@@H](C)[C@H](C(=O)OC)N.Cl |
|
GGTBEWGOPAFTTH-KGZKBUQUSA-N |
|
InChI=1S/C7H15NO2.ClH/c1-4-5(2)6(8)7(9)10-3;/h5-6H,4,8H2,1-3H3;1H/t5-,6-;/m1./s1 |
|
No |
|
Semiochemical; Insecticide; Fungicide |
|
Plant-derived substance; Plant oil |
|
Food grade quality |
|
EU dossier: none reported |
|
Natural; Complex mixture |
|
As a repellent works via scent masking - aroma originates from plant roots and foliage rich in linoleic, oleic and palmitic acids. Mode of action as a fungicide is unreported. |
|
Extracted from the bulb of Allium cepa L. |
|
Oil is produced by steam distillation. Aqueous extracted produced with high temperature water |
|
Crop protection |
|
Carrot root fly (psila rosae); Early blight; Tomato late blight; Grey mould |
|
Carrots, Celeriac, Parsnips, Parsley; Potatoes, Tomatoe; Cucumber |
|
- |
|
8002-72-0 |
|
232-498-2 |
|
- |
|
- |
|
53472027 |
|
181.66 |
|
methyl (2R,3R)-2-amino-3-methylpentanoate;hydrochloride |
|
methyl (2R,3R)-2-amino-3-methylpentanoate;hydrochloride |
|
- |
|
- |
|
Approved via EU & UK 'Basic substance' legislation (Article 28 of Regulation (EC) No 1107/2009) |
|
- |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
Oily amber to yellow coloured liquid comprised of various fatty acids dominated by linoleic acid (~65%) |
|
|
|
|
- |
- |
|
Use in oil dispensers as insect repellent and as a spray when used as a fungicide |
|
|
|
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
41 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
1.02 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
- |
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
- |
Soil adsorption and mobility |
|
None
Terrestrial ecotoxicology |
|
|
|
|
|
> 1000 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Rat |
Moderate |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
- |
- |
- |
|
> 1000 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Rat |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
None allocated |
|
- |
|
None allocated |
|
- |
|
None allocated |
|
- |
|
None allocated |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
Minimal risks for the public from proposed uses |
|
PPC recommended |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
XNo, known not to cause a problem |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
Eye irritant |
Phototoxicant |
  |
✓Yes, known to cause a problem |
XNo, known not to cause a problem |
  |
|
|
Irritant and skin sensitiser |
|
|
|
Flammable liquid when forumated as an oil Use foam or carbon dioxide in firefighting - not water May produce hazardous organic compounds in a fire Not oxidising agent IMDG Transport Hazard Class 3 |
|
Health: H226, H317 Environment: H401, H410 |
|
Not listed (Not listed) |
|
UN1197 |
|
Packaging Group III (minor danger) |
|
- |
|
|
|
onion oil |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
Record last updated: |
30/04/2025 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |