Sodium metabisulphite |

Last updated: 28/05/2025
|
 |
(Also known as: sodium metabisulfite; sodium pyrosulfite; disodium metabisulfite) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
  |
|
|
|
An inorganic substance used in the food industry to preserve fresh, tinned and dried foodstuffs |
|
Food-borne bacteria |
|
Food storage areas; Food prepapartion areas |
|
- |
|
- |
|
Current |
|
- |
|
- |
|
Not approved |
|
Not applicable |
|
No UK approval for use as a plant protection agent |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
- |
|
Not applicable |
|
Not applicable |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
  |
  |
  |
  |
  |
  |
  |
  |
  |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
  |
  |
  |
  |
  |
  |
  |
  |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
  |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
  |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
None |
|
Na₂S₂O₅ |
|
[O-]S(=O)S(=O)(=O)[O-].[Na+].[Na+] |
|
- |
|
HRZFUMHJMZEROT-UHFFFAOYSA-L |
|
InChI=1S/2Na.H2O5S2/c;;1-6(2)7(3,4)5/h;;(H,1,2)(H,3,4,5)/q2*+1;/p-2 |
|
Yes |
|
Fungicide; Other substance |
|
Preservative; Biocide; Antimicrobial |
|
Inorganic compound |
|
- |
|
- |
|
Natural |
|
Acts by releasing sulfur dioxide which inhibits the growth of bacteria, yeasts, and molds.The sulphur dioxide disrupts cellular metabolism, interfering with enzyme activity, and damaging microbial cell walls, leading to cell death |
|
A naturally occurring amino acid |
|
Produced from the reaction between sulphur dioxide with sodium carbonate |
|
Food preservation |
|
Food-borne bacteria |
|
- |
|
- |
|
7681-57-4 |
|
231-673-0 |
|
- |
|
- |
|
656671 |
|
016-063-00-2 |
|
190.11 |
|
sodium metabisulfite |
|
sodium metabisulfite |
|
sodium metabisulfite |
|
- |
|
- |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
None |
|
- |
|
White to pale yellow powder with a sulphurous odour |
|
|
|
|
|
653000 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
High |
|
10.0 |
Acetone |
- |
62000 |
Methanol |
- |
10.0 |
Ethyl acetate |
- |
10.0 |
Toluene |
- |
|
170 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
Decomposes on boiling |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
1.48 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
- |
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
- |
Soil adsorption and mobility |
|
None
Terrestrial ecotoxicology |
|
|
|
|
|
> 420 |
Rat |
Moderate |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
215 |
Unknown species |
Low |
|
316 |
Unknown species 34 days |
Low |
|
- |
- |
- |
|
89 |
Daphnia magna |
Moderate |
|
10 |
Daphnia magna |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
> 420 |
Rat |
Moderate |
|
2000 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Rat |
- |
|
5.5 |
Rat 4 hr |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
XNo, known not to cause a problem |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
No data found |
No data found |
XNo, known not to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
No data found |
Eye irritant |
Phototoxicant |
  |
✓Yes, known to cause a problem |
No data found |
  |
|
|
May trigger asthma attack |
|
|
|
Corrosive Not expected to auto-ignite; Not highly flammable Not explosive |
|
Health: H302, H313, H318, H319 |
|
Not listed (Not listed) |
|
Not regulated |
|
- |
|
- |
|
|
|
sodium metabisulphite |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
Record last updated: |
28/05/2025 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |