| Dicoumarol |

Last updated: 08/02/2026
|
 |
(Also known as: melitoxin; dicumarol; bishydroxycoumarin) |
The following Pesticide Hazard Tricolour (PHT) alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement. The alerts for Highly Hazardous Pesticides (HHPs) are based on applying the FAO/WHO (Type 1) and the PAN (Type II) criteria to PPDB data. Further details on the HHP indicators are given in the tables below. Neither the PHT nor the HHP hazard alerts take account of usage patterns or exposure, thus they do not represent risk.
| PHT: Environmental fate |
PHT: Ecotoxicity |
PHT: Human health |
Highly Hazardous Pesticide |
|   |
  |
|
  |
|
|
A natuirally occurring anticoagulant rodenticide similar to warfarin now considered obsolete |
|
|
Rodent damage |
|
|
Rats; Mice |
|
|
- |
|
|
- |
|
|
- |
|
|
Not approved |
|
|
Not applicable |
|
|
No UK approval for use as a plant protection agent |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
No |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
|   |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
|
None |
|
|
C₁₉H₁₂O₆ |
|
|
C1=CC=C2C(=C1)C(=C(C(=O)O2)CC3=C(C4=CC=CC=C4OC3=O)O)O |
|
|
- |
|
|
DOBMPNYZJYQDGZ-UHFFFAOYSA-N |
|
|
InChI=1S/C19H12O6/c20-16-10-5-1-3-7-14(10)24-18(22)12(16)9-13-17(21)11-6-2-4-8-15(11)25-19(13)23/h1-8,20-21H,9H2 |
|
|
Yes |
| Cambridge Crystallographic Data Centre diagrams |
|
|
| Common Name |
Relationship |
Link |
| dicoumarol |
- |
 |
|
|
Rodenticide |
|
|
Coumarin rodenticide; Plant-derived substance; Micro-organism derived substance |
|
|
- |
|
|
- |
|
|
Natural |
|
|
An anticoagulant chemical that is a competitive inhibitor of vitamin K epoxide reductase |
|
|
Has a combined plant and fungal origin that is a derivative of coumarin, discovered from the spoilage of sweet clover (Melilotus officinalis (L.) Pall) |
|
|
Pest control |
|
|
- |
|
|
66-76-2 |
|
|
200-632-9 |
|
|
253 |
|
|
- |
|
|
54676038 |
|
|
607-060-00-2 |
|
|
336.3 |
|
|
3,3′-methylenebis(4-hydroxy-2H-1-benzopyran-2-one) |
|
|
3,3′-methylenebis(4-hydroxy-2H-chromen-2-one) |
|
|
3,3′-methylenebis[4-hydroxy-2H-1-benzopyran-2-one] |
|
|
| UK Poisons List Order 1972 |
Rotterdam Convention |
Montreal Protocol |
|
|
|
| Stockholm Convention |
OSPAR |
EU Water Framework Directive |
|
|
|
|
|
|
- |
|
|
- |
|
|
|
- |
|
|
- |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
- |
|
|
Off-white crystalline powder with slight sweet odour |
|
|
|
|
|
Considered obsolete but may be available in some countries |
|
|
1930-1940, first identified |
|
|
- Abbott Laboratories
- Eli Lilly and Co
- E.R. Squibb & Sons
|
|
|
- |
|
|
Typically formulated as bait |
|
|
Dicoumarol is commercially produced by synthesising dicoumarol through microbial fermentation or chemical oxidation of coumarin-rich substrates, such as spoiled sweet clover or synthetic coumarin derivatives. In industrial settings, moulds like Penicillium or Aspergillus are cultivated under controlled conditions to convert coumarin into dicoumarol via hydroxylation and dimerisation. Once the compound is formed, it’s extracted using organic solvents and purified through crystallisation or chromatography. |
|
|
As microbial-based products tend to use fermentation-based production processes rather than chemical synthesis, they typically have a lower fossil fuel input in formulation and active ingredient creation, and also have reduced downstream emissions due to biodegradability and minimal soil disruption, their life-cycle GHG emissions are expected to be low. Whilst hard and precise data is not available, broad estimates suggest that typically emissions are likely to be below 5 kg CO₂e/kg. |
|
|
|
|
|
|
|
|
|
|
128 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Moderate |
|
|
Insoluble |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Acetone |
- |
| Insoluble |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Ether |
- |
|
|
290 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
1.17 X 1002 |
Calculated |
- |
|
|
2.07 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
|
- |
| Soil adsorption and mobility |
|
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
233 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Mouse |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
- |
- |
- |
|
|
- |
|
|
|
|
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
| Regulatory Threshold Levels (RTLs) |
|
Note: These RTLs have been calculated using the regulatory approach used in the European Union and based on ecotoxocity values in the PPDB.
|
|
|
|
|
|
23.3 |
Worst case of acute and chronic mammals |
|
|
No data |
No data for acute and chronic birds |
|
|
No data |
No data for acute and chronic earthworms |
|
|
No data |
No data for non-target plants vegetative vigour and seedling emergence |
|
|
No data |
No data for contact and oral honeybees |
|
|
No data |
No data for parasitic wasps and predatory mites |
|
|
No data |
No data for temperate acute and chronic fish |
|
|
No data |
No data for temperate acute and chronic aquatic invertebrates |
|
|
No data |
No data for free-floating plants, rooted plants, acute and chronic algae |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
233 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Mouse |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
Excreted in urine and faeces following hepatic metabolism |
Q4 Q = Miscellaneous data from online sources 4 = Verified data |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
| No data found |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
?Possibly, status not identified |
No data found |
No data found |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
| No data found |
?Possibly, status not identified |
?Possibly, status not identified |
| Eye irritant |
Phototoxicant |
  |
?Possibly, status not identified |
No data found |
  |
|
|
|
Highly toxic via the oral route May cause gastrointestinal tract discomfort resulting in nausea and vomiting |
|
|
|
|
|
When heated to decomposition will emit acrid smoke and fumes IMDG Transport Hazard Class 6.1 |
|
|
Not classified |
|
|
Not listed |
|
|
UN2811 |
|
|
Packaging Group III (minor danger) |
|
|
- |
|
|
|
|
|
dicoumarol |
|
|
dicoumarol |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
| Record last updated: |
08/02/2026 |
| Contact: |
aeru@herts.ac.uk |
| Please cite as: |
Tzilivakis, J., Lewis, K.A., Green, A. and Warner, D.J. (2026) A decade of growth and impact of the Pesticide Properties Database (PPDB). Human and Ecological Risk Assessment: An International Journal, 1–26. DOI: 10.1080/10807039.2026.2702066
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242
|
© Copyright University of Hertfordshire, 2006-2026. All Rights Reserved
Your use of this website and its various databases is subject to the terms detailed in the University of Hertfordshire’s copyright and IPR statement that can be found at https://www.herts.ac.uk/about-us/legal.
In addition, your use of this website and its various databases is subject to the terms of this additional Copyright Statement and the database Conditions of use.
Unless explicitly stated otherwise, the content of this website and databases are owned and controlled by the University of Hertfordshire. Site content, including its selection and arrangement, is owned by the University of Hertfordshire and is protected by copyright and other laws.
Except as otherwise expressly permitted under copyright law or within the database Conditions of Use document, the content of this site may not be copied, reproduced, republished, downloaded, posted, broadcast or transmitted in any way without first obtaining the University of Hertfordshire’s written permission.
By using our databases the user is deemed to have agreed to comply with all of the terms and conditions as described above and within all relevant documentation.