Dibutyl succinate |
Last updated: 22/08/2024
|
|
(Also known as: 2,4-dinitrofluorobenzene sulfonic acid; butanedioic acid, 1,4-dibutyl ester) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
  |
|
|
|
A substance, considered to be obsolete as a pesticide, that is produced by an insect-pathogenic fungus. It has multiple uses as an insect repellent |
|
Aphids; Ants; Roaches |
|
Livestock; Domestic situations |
|
- |
|
- |
|
Considered obsolete but may be available in some countries |
|
circa 1985, introduced |
|
- |
|
Not approved |
|
Not applicable |
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
No |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
  |
  |
  |
  |
  |
  |
  |
  |
  |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
  |
  |
  |
  |
  |
  |
  |
  |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
  |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
  |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
None |
|
C₁₂H₂₂O₄ |
|
CCCCOC(=O)CCC(=O)OCCCC |
|
- |
|
YUXIBTJKHLUKBD-UHFFFAOYSA-N |
|
InChI=1S/C12H22O4/c1-3-5-9-15-11(13)7-8-12(14)16-10-6-4-2/h3-10H2,1-2H3 |
|
Yes |
Cambridge Crystallographic Data Centre diagrams |
|
|
Common Name |
Relationship |
Link |
dibutyl succinate |
- |
|
|
Insecticide, Fungicide, Semiochemical, Other substance, Veterinary substance |
|
Surfactant |
|
Micro-organism derived substance; Dicarboxylic acid |
|
- |
|
- |
|
Natural |
|
Insect repellent but there is also some evidence that dibutyl succinate causes mortality in nymphs of the green peach aphid and inhibits the growth of fungal plant pathogens |
|
Produced by an insect-pathogenic fungus, Isaria javanica pf185. Substance is also found in Nicotiana tabacum |
|
- |
|
Animal welfare; Public health |
|
Aphids; Ants; Roaches |
|
Livestock; Domestic situations |
|
- |
|
141-03-7 |
|
205-449-8 |
|
- |
|
077802 |
|
8830 |
|
230.30 |
|
dibutyl butanedioate |
|
dibutyl succinate |
|
dibutyl butanedioate |
|
- |
|
- |
|
Not applicable |
|
Not applicable |
|
Not known |
|
Not known |
|
- |
|
Clear colourless liquid |
|
|
|
|
|
230 |
|
Moderate |
|
Miscible |
Benzene |
- |
|
-29.0 |
|
- |
|
274.5 |
|
- |
|
- |
- |
- |
|
135 |
(open cup) |
- |
|
|
2.45 X 1003 |
Calculated |
- |
|
3.39 |
|
High |
|
|
- |
- |
- |
|
- |
- |
- |
|
0.977 |
|
- |
|
- |
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
- |
Soil adsorption and mobility |
|
None
Terrestrial ecotoxicology |
|
|
|
|
|
8830 |
Rat |
Low |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
> 4.26 |
Unknown species |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
- |
- |
- |
|
8830 |
Rat |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
No data found |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
No data found |
No data found |
No data found |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
?Possibly, status not identified |
No data found |
No data found |
Eye irritant |
Phototoxicant |
  |
No data found |
No data found |
  |
|
|
No information available |
|
|
|
Will emit irritating fumes when heated to decomposition |
|
- |
|
Not classified: Obsolete (Not classified: Obsolete) |
|
UN3082 |
|
Packaging group III (minor danger) |
|
Hydrolized by alkaline substances; Incompatible with strong oxidising agents; Store at room temperature |
|
|
|
dibutyl succinate |
|
succinate de dibutyle |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
Record last updated: |
22/08/2024 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |