D-tagatose (Ref: IFP48) |
Last updated: 25/05/2024
|
|
(Also known as: D-TAG; D-tagatopyranoside) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
  |
  |
|
|
A naturally occurring monsaccharide sugar shown to help control various phytopathogenic oomycetes |
|
Downy mildew; Grey mould; Alternaria sooty spot; Brown rust; Rice sheath blight |
|
Grapes; Tomato; Cucumber; Rice; Chinese cabbage; Onion; Spinach |
|
- |
|
- |
|
Novel |
|
circa 2020, introduced |
|
- |
|
Not approved |
|
Not applicable |
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Pending |
|
Belgium |
|
- |
|
No |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
  |
  |
  |
  |
  |
  |
  |
  |
  |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
  |
  |
  |
  |
  |
  |
  |
  |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
  |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
  |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
D-tagatose is an isomer of fructose |
|
C₆H₁₂O₆ |
|
C1C(C(C(C(O1)(CO)O)O)O)O |
|
C1[C@H]([C@@H]([C@@H](C(O1)(CO)O)O)O)O |
|
LKDRXBCSQODPBY-OEXCPVAWSA-N |
|
InChI=1S/C6H12O6/c7-2-6(11)5(10)4(9)3(8)1-12-6/h3-5,7-11H,1-2H2/t3-,4+,5+,6?/m1/s1 |
|
Yes |
|
Fungicide, Other substance |
|
Sweetener, Stabilizer, Humectant,Texturizer |
|
Unclassified substance; Monosaccharide fungicide; Plant- and animal-derived substance |
|
- |
|
- |
|
Natural |
|
Protective and preventative. Inhibits mannose metabolism essential for oomycetes development. |
|
D-tagatose is a rare monosaccharide, naturally present at low concentrations in some fruits and dairy products |
|
- |
|
Crop protection |
|
Downy mildew; Grey mould; Alternaria sooty spot; Brown rust; Rice sheath blight |
|
Grapes; Tomato; Cucumber; Rice; Chinese cabbage; Onion; Spinach |
|
- |
|
87-81-0 |
|
201-772-3 |
|
- |
|
- |
|
439312 |
|
180.16 |
|
(3S,4S,5R)-2-(hydroxymethyl)oxane-2,3,4,5-tetrol |
|
(3S,4S,5R)-2-(hydroxymethyl)oxane-2,3,4,5-tetrol |
|
- |
|
US GRAS status |
|
- |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
- |
|
- |
|
White crystalline solid |
|
|
|
|
- |
- |
|
Shown to be affective via foliar spray, soil drenching, or seed treatment |
|
|
|
|
|
- |
- |
- |
|
- |
- |
- |
|
133 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
- |
Soil adsorption and mobility |
|
None
Terrestrial ecotoxicology |
|
|
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
XNo, known not to cause a problem |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
No data found |
No data found |
No data found |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
No data found |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
Eye irritant |
Phototoxicant |
  |
XNo, known not to cause a problem |
No data found |
  |
|
|
No information available |
|
|
|
No information available |
|
- |
|
- |
|
- |
|
- |
|
- |
|
|
|
D-tagatose |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
Record last updated: |
25/05/2024 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |