| Caffeine |

Last updated: 31/01/2026
|
 |
(Also known as: 1,3,7-trimethylxanthine) |
| This is a plant-derived substance for which limited data is currently available. The substance is not commercially available as a pesticide but is currently subject to the EU regulatory risk assessment.. |
The following Pesticide Hazard Tricolour (PHT) alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement. The alerts for Highly Hazardous Pesticides (HHPs) are based on applying the FAO/WHO (Type 1) and the PAN (Type II) criteria to PPDB data. Further details on the HHP indicators are given in the tables below. Neither the PHT nor the HHP hazard alerts take account of usage patterns or exposure, thus they do not represent risk.
| PHT: Environmental fate |
PHT: Ecotoxicity |
PHT: Human health |
Highly Hazardous Pesticide |
|   |
|
|
  |
|
|
A plant alkaloid which has strong insecticidal and molluscicidal activity |
|
|
Slugs; Snails |
|
|
Brassicas; Potatoes; Ornamentals |
|
|
- |
|
|
- |
|
|
- |
|
|
Not approved |
|
|
Not applicable |
|
|
No UK approval for use as a plant protection agent |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Not applicable |
|
|
No |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
|   |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
|
Caffeine itself is not stereoisomeric, but it does have structural isomers and shares its molecular formula with other xanthine alkaloids like theobromine that is found in chocolate and theophylline used in asthma medications. These differ in the position of methyl groups on the xanthine ring, giving them distinct pharmacological effects despite similar structures. |
|
|
C₈H₁₀N₄O₂ |
|
|
CN1C=NC2=C1C(=O)N(C(=O)N2C)C |
|
|
- |
|
|
RYYVLZVUVIJVGH-UHFFFAOYSA-N |
|
|
InChI=1S/C8H10N4O2/c1-10-4-9-6-5(10)7(13)12(3)8(14)11(6)2/h4H,1-3H3 |
|
|
Yes |
| Cambridge Crystallographic Data Centre diagrams |
|
|
| Common Name |
Relationship |
Link |
| caffeine |
- |
 |
|
|
Insecticide; Acaricide; Molluscicide; Other substance |
|
|
Food additive; Food supplement; Biocide |
|
|
Plant-derived substance |
|
|
98.5 |
|
|
EFSA technical report: Arsenic < 3 mg kg⁻¹; Lead < 0.002% |
|
|
Natural |
|
|
Natural toxin which when consumed paralyses and kill insects |
|
|
Naturally occurring substance commonly sourced from the coffee bean, tea leaves and cacao beans |
|
|
Crop protection |
|
|
Slugs and snails |
|
|
Brassicas; Potatoes; Ornamentals |
|
|
- |
|
|
58-08-2 |
|
|
200-362-1 |
|
|
- |
|
|
- |
|
|
2519 |
|
|
194.19 |
|
|
1,3,7-trimethyl-3,7-dihydro-1H-purine-2,6-dione |
|
|
1,3,7-trimethyl-3,7-dihydro-1H-purine-2,6-dione |
|
|
1,3,7-trimethyl-3,7-dihydro-1H-purine-2,6-dione |
|
|
| UK Poisons List Order 1972 |
Rotterdam Convention |
Montreal Protocol |
|
|
|
| Stockholm Convention |
OSPAR |
EU Water Framework Directive |
|
|
|
|
|
|
- |
|
|
- |
|
|
|
- |
|
|
- |
|
|
E150; FEMA 2224; FLAVIS=16.015 |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not classified |
|
|
Not applicable |
|
|
- |
|
|
Odourless white crystalline powder |
|
|
|
|
|
Novel |
|
|
early-1990s, informal use recorded |
|
|
|
|
|
- |
|
|
Available in a variety of formulations including suspension concentrates for direct application and granules |
|
|
Commercial production of caffeine may be achieved via both natural extraction and synthetic synthesis, depending on the intended application and scale. Naturally, caffeine is extracted from plant sources such as coffee beans, tea leaves, guarana, and yerba mate. The process typically includes water or solvent extraction, followed by filtration, purification, and crystallisation to isolate caffeine in its pure form. On the synthetic side, caffeine can be produced through chemical synthesis using compounds like urea and cyanoacetic acid, though this method is less common due to cost and complexity. The purified caffeine is then formulated into products for use. |
|
|
GHG emissions from caffeine production are not available. Most studies focus on the carbon footprint of coffee as a whole, not isolated caffeine. For coffee, producing 1 kg of green Arabica coffee beans using conventional methods emits approximately 15.33 kg of CO₂e. Extraction of caffeine from coffee beans involves solvent use (e.g. methylene chloride or CO₂ in supercritical extraction) and energy-intensive steps like drying and purification. Consequently, the GHG emissions for caffeine are likely to be considerably higher than that for coffee. |
|
|
|
|
|
|
|
|
|
|
2170 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source at 25°C |
High |
|
|
- |
- |
- |
|
|
235 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
178 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1.23 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
|
- |
| Soil adsorption and mobility |
|
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
> 433 |
Rat |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
- |
- |
- |
|
|
- |
|
|
|
|
|
|
|
> 150 |
Pimephales promelas
| Low |
|
|
- |
- |
- |
|
|
736 |
Danio rerio |
Low |
|
|
177.5 |
Daphnia magna |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 150 |
Raphidocelis subcapitata |
Low |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
| Regulatory Threshold Levels (RTLs) |
|
Note: These RTLs have been calculated using the regulatory approach used in the European Union and based on ecotoxocity values in the PPDB.
|
|
|
|
|
|
43.3 |
Worst case of acute and chronic mammals |
|
|
No data |
No data for acute and chronic birds |
|
|
No data |
No data for acute and chronic earthworms |
|
|
No data |
No data for non-target plants vegetative vigour and seedling emergence |
|
|
No data |
No data for contact and oral honeybees |
|
|
No data |
No data for parasitic wasps and predatory mites |
|
|
1.5 |
Worst case of temperate acute and chronic fish |
|
|
1.775 |
Worst case of temperate acute and chronic aquatic invertebrates |
|
|
15 |
Worst case of free-floating plants, rooted plants, acute and chronic algae |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
|
- |
- |
- |
|
|
> 433 |
Rat |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
Rapidly eliminated in the urine |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
XNo, known not to cause a problem |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
| No data found |
No data found |
✓Yes, known to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
| No data found |
✓Yes, known to cause a problem |
No data found |
| Eye irritant |
Phototoxicant |
  |
✓Yes, known to cause a problem |
No data found |
  |
|
|
|
CNS stimulant May cause psychotropic effects Demonstrates anti-inflammatory activity |
|
|
|
|
|
No information available |
|
|
- |
|
|
Not listed (Not listed) |
|
|
UN1544 |
|
|
- |
|
|
- |
|
|
|
|
|
caffeine |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
| Record last updated: |
31/01/2026 |
| Contact: |
aeru@herts.ac.uk |
| Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |
© Copyright University of Hertfordshire, 2006-2026. All Rights Reserved
Your use of this website and its various databases is subject to the terms detailed in the University of Hertfordshire’s copyright and IPR statement that can be found at
https://www.herts.ac.uk/about-us/legal.
In addition, your use of this website and its various databases is subject to the terms of this additional Copyright Statement and the database
Conditions of use document.
Unless explicitly stated otherwise, the content of this website and databases are owned and controlled by the University of Hertfordshire. Site content, including its selection and arrangement, is owned by the University of Hertfordshire and is protected by copyright and other laws.
Except as otherwise expressly permitted under copyright law or within the database Conditions of Use document, the content of this site may not be copied, reproduced, republished, downloaded, posted, broadcast or transmitted in any way without first obtaining the University of Hertfordshire’s written permission.
By using our databases the user is deemed to have agreed to comply with all of the terms and conditions as described above and within all relevant documentation.