Curcumenol |

Last updated: 08/06/2025
|
 |
(Also known as: (+)-curcumenol) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
  |
  |
|
|
A plant-derived substance explored for use as a rodenticide and insecticide |
|
Mosquitoes (Aedes albopictus, Culex pipiens); Various insect larvae; Rodents |
|
Various crops; Public spaces; Farm buildings |
|
- |
|
- |
|
Experimental |
|
- |
|
Family: Zingiberaceae |
|
Not approved |
|
Not applicable |
|
No UK approval for use as a plant protection agent |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
No |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
  |
  |
  |
  |
  |
  |
  |
  |
  |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
  |
  |
  |
  |
  |
  |
  |
  |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
  |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
  |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
Isomeric existing in two isomeric forms generally referred to as curcumenol isomer I and II. |
|
C₁₅H₂₂O₂ |
|
C[C@H]1CC[C@@H]2[C@]13CC(=C(C)C)[C@](O3)(C=C2C)O |
|
- |
|
ISFMXVMWEWLJGJ-NZBPQXDJSA-N |
|
InChI=1S/C15H22O2/c1-9(2)13-8-14-11(4)5-6-12(14)10(3)7-15(13,16)17-14/h7,11-12,16H,5-6,8H2,1-4H3/t11-,12-,14-,15+/m0/s1 |
|
Yes |
|
Rodenticide; Insecticide; Larvicide; Repellent |
|
Unclassified rodenticide |
|
- |
|
- |
|
Natural |
|
It has been shown to induce autophagic cell death in insect cells. It can also inhibit the growth and development of insect larvae. As a rodenticide it tends to act as a repellent due to its pungent taste and odour |
|
Found in the Indonesian plant Curcuma xanthorrhiza, Turmeric Curcuma longa, Curcuma wenyujin and the herb Artemisia annua |
|
Commercially produced through extraction from Curcuma species, particularly Curcuma wenyujin |
|
Crop protection; Public health |
|
Mosquitoes (Aedes albopictus, Culex pipiens); Various insect larvae; Rodents |
|
- |
|
- |
|
19431-84-6 |
|
- |
|
- |
|
- |
|
167812 |
|
234.33 |
|
(3S,3aS,6R,8aS)-3,8-dimethyl-5-(propan-2-ylidene)-1,2,3,4,5,8a-hexahydro-6H-3a,6-epoxyazulen-6-ol |
|
(1S,2S,5S,8R)-9-isopropylidene-2,6-dimethyl-11-oxatricyclo[6.2.1.01,5]undec-6-en-8-ol |
|
(3S,3aS,6R,8aS)-1,2,3,4,5,8a-hexahydro-3,8-dimethyl-5-(1-methylethylidene)-6H-3a,6-epoxyazulen-6-ol |
|
- |
|
- |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
- |
|
- |
|
|
|
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
347 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
- |
- |
- |
|
146.7 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
1.26 X 1003 |
Calculated |
- |
|
3.1 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
High |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
- |
Soil adsorption and mobility |
|
None
Terrestrial ecotoxicology |
|
|
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Intraperitoneal LD₅₀ = 250 mg kg⁻¹ |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Mouse |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
XNo, known not to cause a problem |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
No data found |
Eye irritant |
Phototoxicant |
  |
XNo, known not to cause a problem |
No data found |
  |
|
|
A very high dose may cause liver injury that is typically hepatocellular May cause headaches or diarrhea at high doses |
|
|
|
No information available |
|
- |
|
- |
|
- |
|
- |
|
- |
|
|
|
curcumenol |
|
curcuménol |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
Record last updated: |
08/06/2025 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |