| Anthraquinone |

Last updated: 05/02/2026
|
 |
(Also known as: anthradione) |
| Anthraquinone is a substance used as a bird repellent. It has a low aqueous solubility, volatile with a low risk of leaching to groundwater. it is non-persistent in soil but can be persistent in water under certain conditions. It shows a low mammalian toxicity but there are some concerns regarding its potential to bioaccumulate. No serious risks to human health have been reported. It is moderately toxic to birds, most aquatic organisms and earthworms. No data is available regarding the risk to honeybees. |
The following Pesticide Hazard Tricolour (PHT) alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement. The alerts for Highly Hazardous Pesticides (HHPs) are based on applying the FAO/WHO (Type 1) and the PAN (Type II) criteria to PPDB data. Further details on the HHP indicators are given in the tables below. Neither the PHT nor the HHP hazard alerts take account of usage patterns or exposure, thus they do not represent risk.
| PHT: Environmental fate |
PHT: Ecotoxicity |
PHT: Human health |
Highly Hazardous Pesticide |
|
|
|
|
|
|
Substance used primarily as a bird repellent formulated as a seed treatment |
|
|
Birds such as rooks and crows |
|
|
Agricultural cropping |
|
|
- |
|
|
- |
|
|
- |
|
|
Not approved |
|
|
Expired |
|
|
No UK approval for use as a plant protection agent |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Belgium |
|
|
Expired |
|
|
Not applicable |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
|   |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
|
None |
|
|
C₁₄H₈O₂ |
|
|
C1=CC=C2C(=C1)C(=O)C3=CC=CC=C3C2=O |
|
|
No data |
|
|
RZVHIXYEVGDQDX-UHFFFAOYSA-N |
|
|
InChI=1S/C14H8O2/c15-13-9-5-1-2-6-10(9)14(16)12-8-4-3-7-11(12)13/h1-8H |
|
|
Yes |
| Cambridge Crystallographic Data Centre diagrams |
|
|
| Common Name |
Relationship |
Link |
| anthraquinone |
- |
 |
|
|
Repellent |
|
|
Polycyclic aromatic hydrocarbon; Plant-derived substance; Animal-derived susbtance |
|
|
- |
|
|
- |
|
|
Natural |
|
|
Non-toxc mode of action. It induces retching in birds and so deters attack |
|
|
The anthraquinones occur widely in plants and also in a few animals. |
|
|
Crop protection - bird repellent |
|
|
Birds |
|
|
Field crops |
|
|
- |
|
|
84-65-1 |
|
|
201-549-0 |
|
|
290 |
|
|
122701 |
|
|
6780 |
|
|
208.21 |
|
|
anthracene-9,10-dione |
|
|
anthracene-9,10-dione |
|
|
9,10-anthracenedione |
|
|
| UK Poisons List Order 1972 |
Rotterdam Convention |
Montreal Protocol |
|
|
|
| Stockholm Convention |
OSPAR |
EU Water Framework Directive |
|
|
|
|
|
|
- |
|
|
- |
|
|
|
Yes [ C2 Criterion 2: Pesticide active ingredients that meet the criteria of carcinogenicity Categories 1A and 1B of the Globally Harmonized System on Classification and Labelling of Chemicals (GHS) (those with a CLP classification of H350) ] |
|
|
Yes [ R02 Rule 2: Pesticide active ingredients that meet the criteria of carcinogenicity Categories 1A and 1B of the Globally Harmonized System on Classification and Labelling of Chemicals (GHS) (those with a CLP classification of H350) ] |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
- |
|
|
Yellow to green-grey crystals with a weak odour. |
|
|
|
|
|
- |
|
|
1951, introdcued France; 1999, first registered USA |
|
|
- Arkon Life Sciences
- Bayer CropScience
|
|
|
- Flight Control Plus
- Corbit
- Morkit
- Repell
|
|
|
Usually supplied as a seed treatment |
|
|
Anthraquinone is produced commercially through a chemical synthesis process that typically begins with phthalic anhydride and benzene as key raw materials. These compounds undergo a Friedel–Crafts acylation reaction in the presence of a Lewis acid catalyst such as aluminum chloride, forming o-benzoylbenzoic acid. This intermediate is then cyclised and oxidised to yield anthraquinone. |
|
|
GHG emissions data for anthraquinone production are not available publicly, However, efforts to reduce emissions in related supply chains, such as hydrogen peroxide production, which relies on anthraquinone, have shown promising results. Some companies have reduced Scope 3 emissions by over 50% by sourcing aluminum chloride with a lower carbon footprint, a key input in anthraquinone synthesis. This indicates that while anthraquinone production does contribute to GHG emissions, strategic sourcing and cleaner energy inputs can significantly mitigate its environmental impact. |
|
|
|
|
|
|
|
|
|
|
0.084 |
W4 W = French database provided by ARVALIS-Institut du Végétal. Dataset no longer available. 4 = Verified data |
Low |
|
|
2314 |
C4 C = AGRITOX dataset. Dataset is no longer available. 4 = Verified data Benzene |
- |
| 9030 |
C4 C = AGRITOX dataset. Dataset is no longer available. 4 = Verified data Chloroform |
- |
| 3520 |
C4 C = AGRITOX dataset. Dataset is no longer available. 4 = Verified data Ethanol |
- |
| 2598 |
C4 C = AGRITOX dataset. Dataset is no longer available. 4 = Verified data Toluene |
- |
|
|
286 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
377 |
|
- |
|
|
- |
- |
- |
|
|
185 |
(closed cup) |
- |
|
|
|
3.31 X 1003 |
Calculated |
- |
|
|
3.52 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
High |
|
|
|
Soluble |
|
- |
|
|
Regulatory data - observed in metabolism and farm animal feeding studies |
|
- |
|
|
1.44 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
7.4 |
|
- |
| Weak acid |
|
|
5.00 X 10-03 |
C4 C = AGRITOX dataset. Dataset is no longer available. 4 = Verified data |
Low volatility |
|
|
3.50 X 10-05 |
C4 C = AGRITOX dataset. Dataset is no longer available. 4 = Verified data |
Non-volatile |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
8 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Best available data |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
Stable |
W4 W = French database provided by ARVALIS-Institut du Végétal. Dataset no longer available. 4 = Verified data |
Stable |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
|
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
W3 W = French database provided by ARVALIS-Institut du Végétal. Dataset no longer available. 3 = Unverified data of known source |
Slightly mobile |
|
|
3215 |
|
|
Best available data |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
> 5000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 2000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Coturnix japonica |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 1000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Eisenia foetida |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
- |
- |
- |
|
|
- |
|
|
|
|
|
|
|
> 72 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Oncorhynchus mykiss |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 10 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Daphnia magna |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 0.942 |
Americamysis bahia |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
~ 0.2 |
Lemna gibba |
Moderate |
|
|
- |
- |
- |
|
|
10 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Desmodesmus subspicatus |
Moderate |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
| Regulatory Threshold Levels (RTLs) |
|
Note: These RTLs have been calculated using the regulatory approach used in the European Union and based on ecotoxocity values in the PPDB.
|
|
|
|
|
|
500 |
Worst case of acute and chronic mammals |
|
|
200 |
Worst case of acute and chronic birds |
|
|
200 |
Worst case of acute and chronic earthworms |
|
|
No data |
No data for non-target plants vegetative vigour and seedling emergence |
|
|
No data |
No data for contact and oral honeybees |
|
|
No data |
No data for parasitic wasps and predatory mites |
|
|
0.72 |
Worst case of temperate acute and chronic fish |
|
|
0.1 |
Worst case of temperate acute and chronic aquatic invertebrates |
|
|
0.02 |
Worst case of free-floating plants, rooted plants, acute and chronic algae |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
> 5000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 5000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
|
1.33 |
Rat 4 hr |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
✓Yes, known to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
XNo, known not to cause a problem |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
?Possibly, status not identified |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
| No data found |
✓Yes, known to cause a problem |
?Possibly, status not identified |
| Eye irritant |
Phototoxicant |
  |
| No data found |
No data found |
  |
|
|
|
IARC Group 2B carcinogen; CLP data - known human carcinogen May be harmful by ingestion, inhalation and through skin contact May cause dermatitis |
|
|
|
|
|
No information available |
|
|
Health: H350 |
|
|
U (Unlikely to present an acute hazard) |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
anthraquinone |
|
|
anthraquinone |
|
|
Anthrachinon |
|
|
anthraquinon |
|
|
antrachinone |
|
|
antraquinona |
|
|
- |
|
|
antrachinon |
|
|
- |
|
|
antrachinon |
|
|
- |
|
|
- |
| Record last updated: |
05/02/2026 |
| Contact: |
aeru@herts.ac.uk |
| Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |
© Copyright University of Hertfordshire, 2006-2026. All Rights Reserved
Your use of this website and its various databases is subject to the terms detailed in the University of Hertfordshire’s copyright and IPR statement that can be found at
https://www.herts.ac.uk/about-us/legal.
In addition, your use of this website and its various databases is subject to the terms of this additional Copyright Statement and the database
Conditions of use document.
Unless explicitly stated otherwise, the content of this website and databases are owned and controlled by the University of Hertfordshire. Site content, including its selection and arrangement, is owned by the University of Hertfordshire and is protected by copyright and other laws.
Except as otherwise expressly permitted under copyright law or within the database Conditions of Use document, the content of this site may not be copied, reproduced, republished, downloaded, posted, broadcast or transmitted in any way without first obtaining the University of Hertfordshire’s written permission.
By using our databases the user is deemed to have agreed to comply with all of the terms and conditions as described above and within all relevant documentation.