Allethrin (Ref: FMC 249) |

Last updated: 24/08/2024
|
 |
(Also known as: palléthrine; S-bioallethrin; toluen-disocianato; esdepallethrine; d-allethrolone chrysanthemumate) |
Allethrin is a pyrethroid insecticide mostly used in amenity and domestic situations. It has a low aqueous solubility, is volatile and, based on its chemical properties, would not be expected to leach to groundwater. It tends to be moderately persistent in most soil systems. Allethrin is moderately toxic to mammals and a recognised irritant. Whilst it is not highly toxic to birds it is moderately toxic to fish, honeybees and earthworms. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
|
|
|
An insecticide used almost exclusively in domestic situation for the control of mainly flying insect pests |
|
Mosquitoes; Domestic flies; Wasps; Ants |
|
Domestic situations |
|
- |
|
Current |
|
1949, first introduced; circa 1954, first registered Japan |
|
Not approved |
|
Expired |
|
No UK approval for use as a pesticide |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Expired |
|
Not applicable |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
A chiral molecule. Allethrin is a isomeric mixture of 8 stereoisomers. |
|
C₁₉H₂₆O₃ |
|
CC1=C(C(=O)CC1OC(=O)C2C(C2(C)C)C=C(C)C)CC=C |
|
- |
|
ZCVAOQKBXKSDMS-UHFFFAOYSA-N |
|
InChI=1S/C19H26O3/c1-7-8-13-12(4)16(10-15(13)20)22-18(21)17-14(9-11(2)3)19(17,5)6/h7,9,14,16-17H,1,8,10H2,2-6H3 |
|
Yes |
|
Insecticide, Veterinary substance |
|
Pyrethroid insecticide |
|
93% |
|
- |
|
Synthetic |
|
Stomach and respiratory action, non-systemic, paralyses insects before killing them. |
|
584-79-2 |
|
209-542-4 |
|
267 |
|
004001/004003 |
|
11442 |
|
006-025-00-3 |
|
302.41 |
|
(1E)-2-methyl-4-oxo-3-(prop-2-en-1-yl)cyclopent-2-en-1-yl (1?,3?)-2,2-dimethyl-3-(2-methylprop-1-en-1-yl)cyclopropane-1-carboxylate |
|
1RS)-3-allyl-2-methyl-4-oxocyclopent-2-enyl (1RS,3RS;1RS,3SR)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarboxylate |
|
2-methyl-4-oxo-3-(2-propenyl)-2-cyclopenten-1-yl 2,2-dimethyl-3-(2-methyl-1-propenyl)cyclopropanecarboxylate |
|
- |
|
- |
|
Not applicable |
|
Not applicable |
|
3A |
|
Not applicable |
|
Blattella germanica |
|
Viscous amber liquid |
|
|
|
|
|
- Farnham Co
- American Cyanamid Co.
- Sumitomo
- Fairfield
|
|
- Alleviate
- Pyresin
- Pynamin
- Exthrin
- A-Pb Food Plant And Grain Mill Fogging Spray
|
|
Usually supplied as an emulsifiable concentrate |
|
|
|
|
|
|
|
0.0001 |
|
Low |
|
Miscible |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source Acetone |
- |
Miscible |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source Ethanol |
- |
655000 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source Hexane |
- |
|
- |
- |
- |
|
281.5 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source |
- |
|
- |
- |
- |
|
87 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
9.12 X 1004 |
Calculated |
- |
|
4.96 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data |
High |
|
|
- |
- |
- |
|
- |
- |
- |
|
1.01 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
- |
- |
- |
- |
|
0.78 |
R4 R = Peer reviewed scientific publications 4 = Verified data at 25°C |
Low volatility. If applied directly to plants, drift is a concern & mitigation is advisable |
|
6.20 X 10-07 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Non-volatile |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
60 |
DW4 DW = Don Wauchope personal database for Pka data: Wauchope, R. D. and Edwards, J. Dissociation constants for pesticide active ingredients: a database and comparison with predicted values. Dataset is no longer available. 4 = Verified data |
Moderately persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
Decomposes rapidly in UV light |
|
|
- |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
Hydrolysis occurs only under alkaline conditions |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
DW3 DW = Don Wauchope personal database for Pka data: Wauchope, R. D. and Edwards, J. Dissociation constants for pesticide active ingredients: a database and comparison with predicted values. Dataset is no longer available. 3 = Unverified data of known source |
Slightly mobile |
|
1400 |
|
Other sources: 9500 mL g⁻¹ (CB2) |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
|
|
|
|
|
1.52 |
Calculated |
Low leachability |
|
|
4.11 X 10-02 |
Calculated |
- |
|
- |
|
High |
Calculated |
- |
|
Slightly mobile |
Calculated |
- |
|
- |
- |
- |
|
|
200 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
Threshold for concern |
|
Not available |
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
685 |
Rat |
Moderate |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
> 2030 |
Colinus virginianus |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
> 1000 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Unknown species |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
> 3.4 |
|
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
> 0.019 |
Oncorhynchus mykiss |
High |
|
0.005 |
Cyprinus carpio |
High |
|
> 1.99 |
Danio rerio |
Moderate |
|
> 0.021 |
Daphnia magna |
High |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
Intermediate (class II) |
- |
- |
|
685 |
Rat |
Moderate |
|
2660 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rabbit |
- |
|
> 3.88 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
Low risk to Europeans as no longer approved for use |
|
Exposure may occur via skin contact or inhalation - PPE/PPC advised |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
Urinary (25 - 50%) and faecal (50-70%) in around 3 days |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E2 E = Unspecified genotoxicity type (miscellaneous data source) 2 = Mixed/ambiguous results |
?Possibly, status not identified |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
No data found |
XNo, known not to cause a problem |
No data found |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
No data found |
Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
Moderately toxic Potential mutagen Kidney and liver toxicant Inhalation may cause asthma, coughing, wheezing, running nose and eyes |
|
|
|
Incompatible with alkalis Sensitive to light |
|
Health: H302, H332 Environment: H400, H410 |
|
II (Moderately hazardous) |
|
- |
|
- |
|
- |
|
|
|
allethrin |
|
allethrine |
|
Allethrin |
|
d-trans-allethrin |
|
alletrina |
|
aletrina |
|
allethrin bioallethrin |
|
aletryna |
|
- |
|
- |
|
allethrin |
|
- |
Record last updated: |
24/08/2024 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |