Aviglycine |

Last updated: 18/07/2024
|
 |
(Also known as: AVG; aminoethoxyvinylglycine) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
|
|
|
A plant growth regulating substance used on top fruit and ornamentals to maximise yields |
|
Growth |
|
Top fruit; Ornamentals |
|
- |
|
- |
|
Current |
|
1997, hydrochloride salt first introduced |
|
- |
|
Not approved |
|
Withdrawn |
|
No UK approval for use as a plant protection agent |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
- |
|
Withdrawn |
|
Not applicable |
|
Yes as the HCl |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
  |
  |
  |
  |
  |
  |
  |
  |
  |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
  |
  |
  |
  |
  |
  |
  |
  |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
  |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
  |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
Aviglycine is a chiral molecule existing in cis- and trans-forms |
|
C₆H₁₂N₂O₃ |
|
C(COC=CC(C(=O)O)N)N |
|
C(CO/C=C/[C@@H](C(=O)O)N)N |
|
USGUVNUTPWXWBA-JRIXXDKMSA-N |
|
InChI=1S/C6H12N2O3/c7-2-4-11-3-1-5(8)6(9)10/h1,3,5H,2,4,7-8H2,(H,9,10)/b3-1+/t5-/m0/s1 |
|
Yes |
|
Plant Growth Regulator |
|
Micro-organism derived substance |
|
- |
|
- |
|
Natural |
|
Inhibits the biosynthesis of ethylene |
|
A naturally occurring amino acid isolated from Streptomyces spp. Aminoethoxyvinylglycine |
|
Manufactured for crop protection applications |
|
Crop protection; Yield enhancement |
|
- |
|
Top fruit; Ornamentals |
|
- |
|
49669-74-1 |
|
73360-07-3 |
|
256-423-8 |
|
- |
|
- |
|
- |
|
160.2 |
|
- |
|
(E)-L-2-[2-(2-aminoethoxy)vinyl]glycine |
|
(2S,3E)-2-amino-4-(2-aminoethoxy)-3-butenoic acid |
|
- |
|
- |
|
- |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
- |
|
Aviglycine is a solid |
|
|
|
|
|
|
ReTain Plant Growth Regulator |
Valent BioSciences Corp. |
|
Usually supplied as a water soluble concentrate applied up to two weeks before harvest |
|
|
|
|
|
4000 |
P2 P = Other non-EU, UK or US Governments and Regulators 2 = Unverified data of unknown source |
High |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
3 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data |
Non-persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Literature values DT₅₀ range 1.6-10 days across all soils, data for the HCl salt |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source |
Non-mobile |
|
4028 |
|
Data for the HCl salt |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
> 5000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Low |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
121 |
Colinus virginianus as HCl salt |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
> 1000 |
Eisenia foetida as HCl salt |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
> 100 |
as HCl salt |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
139 |
Oncorhynchus mykiss as HCl salt |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
135 |
Daphnia magna as HCl salt |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
> 5000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Low |
|
2000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rabbit |
- |
|
1.13 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat 4 hr |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
XNo, known not to cause a problem |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
?Possibly, status not identified |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
?Possibly, status not identified |
Eye irritant |
Phototoxicant |
  |
XNo, known not to cause a problem |
No data found |
  |
|
|
Possible liver, kidney & testes toxicant |
|
|
|
No information available |
|
- |
|
Not listed (Not listed) |
|
- |
|
- |
|
- |
|
|
|
aviglycine |
|
aviglycine |
|
Aviglycin |
|
aviglycine |
|
aviglycine |
|
aviglycine |
|
- |
|
awiglicyny |
|
- |
|
- |
|
- |
|
- |
Record last updated: |
18/07/2024 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |