Aviglycine-HCl (Ref: ABG 3097) |
Last updated: 12/06/2024
|
|
(Also known as: aminoethoxyvinylglycine HCl; AVG HCl; avilglycine hydrochloride; aminoethoxyvinylglycine HCl) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
|
|
|
A plant growth regulating substance used on top fruit and ornamentals to maximise yields |
|
Growth |
|
Top fruit |
|
- |
|
- |
|
Current |
|
1997, introduced |
|
- |
|
Not approved |
|
Expired |
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
UK |
|
Expired |
|
Not applicable |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
  |
  |
  |
  |
  |
  |
  |
  |
  |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
  |
  |
  |
  |
  |
  |
  |
  |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
  |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
  |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
Aviglicine is a chiral molecule. |
|
C₆H₁₃ClN₂O₃ |
|
C(COC=CC(C(=O)O)N)N.Cl |
|
C(CO/C=C/[C@@H](C(=O)O)N)N.Cl |
|
ZDCPLYVEFATMJF-BTIOQYSDSA-N |
|
InChI=1S/C6H12N2O3.ClH/c7-2-4-11-3-1-5(8)6(9)10;/h1,3,5H,2,4,7-8H2,(H,9,10);1H/b3-1+ |
|
Yes |
|
Plant Growth Regulator |
|
Micro-organism derived substance |
|
- |
|
- |
|
Natural |
|
Inhibits the biosynthesis of ethylene |
|
The parent aminoethoxyvinylglycine is a naturally occurring amino acid obtained from a Streptomyces spp. Aminoethoxyvinylglycine |
|
Manufactured for crop protection applications |
|
Crop protection; Yield enhancement |
|
None - PGR |
|
Top fruit |
|
- |
|
55720-26-8 |
|
- |
|
780 |
|
129104 |
|
- |
|
196.63 |
|
- |
|
(E)-L-2-[2-(2-aminoethoxy)vinyl]glycine hydrochloride |
|
aminoethoxyvinylglycine hydrochloride |
|
- |
|
- |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
- |
|
Off-white powder |
|
|
|
|
|
|
ReTain Plant Growth Regulator |
Valent BioSciences Corp. |
|
Usually supplied as a water soluble concentrate applied up to two weeks before harvest |
|
|
|
|
|
4121 |
P2 P = Other non-EU, UK or US Governments and Regulators 2 = Unverified data of unknown source |
High |
|
- |
- |
- |
|
Decomposes before melting |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
Decomposes before boiling |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
178 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
- |
- |
- |
|
|
1.05 X 10-04 |
Calculated |
- |
|
-3.98 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data |
Low |
|
|
- |
- |
- |
|
- |
- |
- |
|
0.42 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data |
- |
|
2.84 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data |
- |
Strong acid; pKa(2): 8.81; pKa(3) = 9.95 |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
3 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data |
Non-persistent |
|
3 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data |
Non-persistent |
|
10 |
|
Non-persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Literature values DT₅₀ range 1.6-10 days across all soils |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source |
Non-mobile |
|
4028 |
|
Best available data |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
6480 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data Rat |
Low |
|
|
5 |
Rat |
High |
|
- |
- |
|
- |
- |
- |
|
121 |
Colinus virginianus |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
1000 |
|
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
100 |
|
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
139 |
Oncorhynchus mykiss |
Low |
|
139 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Oncorhynchus mykiss |
Low |
|
- |
- |
- |
|
135 |
Unknown species |
Low |
|
135 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Daphnia magna |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
6480 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data Rat |
Low |
|
2000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
1.13 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat 4 hr |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
XNo, known not to cause a problem |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
?Possibly, status not identified |
Eye irritant |
Phototoxicant |
  |
✓Yes, known to cause a problem |
No data found |
  |
|
|
Possible liver, kidney & testes toxicant |
|
|
|
No information available |
|
Health: H315, H318, H335 |
|
Not listed (Not listed) |
|
- |
|
- |
|
- |
|
|
|
aviglycine-HCl |
|
aviglycine HCl |
|
Aviglycin-HCl |
|
aviglycine-HCl |
|
aviglycine-HCl |
|
aviglycine-HCl |
|
- |
|
chlorowodorek awiglicyny |
|
- |
|
- |
|
- |
|
- |
Record last updated: |
12/06/2024 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |