Anethole |
Last updated: 12/06/2024
|
|
(Also known as: oil of anise; pimpinella asisum fruit oil; oilofanise; anise oil; anise camphor; trans anethole) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
  |
|
|
|
A natural plant extract, often known as anise oil, which is predominately anethole that has a variety of uses including as an animal and insect repellent |
|
Cats; Dogs; Fleas; Ticks; Lice |
|
Domestic gardens; Leisure/public gardens; Herbaceous plants; Lawns |
|
- |
|
- |
|
Current |
|
1952, first registered, USA; 1993, reregistered, USA |
|
- |
|
Not approved |
|
Not applicable |
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
  |
  |
  |
  |
  |
  |
  |
  |
  |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
  |
  |
  |
  |
  |
  |
  |
  |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
  |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
  |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
Anethole is isomeric existing in both the cis and trans forms. The trans--isomer, is the most abundant form. The cis-isomer is known as estragole |
|
C₁₀H₁₂O |
|
CC=CC1=CC=C(C=C1)OC |
|
C/C=C/C1=CC=C(C=C1)OC |
|
RUVINXPYWBROJD-ONEGZZNKSA-N |
|
InChI=1S/C10H12O/c1-3-4-9-5-7-10(11-2)8-6-9/h3-8H,1-2H3/b4-3+ |
|
Yes |
|
Insecticide, Miticide, Other substance, Semiochemical |
|
Flavouring, Purfumery |
|
Plant-derived substance |
|
- |
|
- |
|
Natural |
|
Broad spectrum, repellent and contact action. |
|
A multi-component plant oil derived from Anise (Pimpinella anisum) which is a herbaceous plant native to Mediterranean regions and South West Asia. |
|
Produced commerical using a steam distillation process and crushed plant seeds |
|
Mammal repellent |
|
Cats; Dogs; Fleas; Ticks; Lice |
|
Domestic gardens; Leisure/public gardens; Herbaceous plants; Lawns |
|
- |
|
4180-23-8 |
|
8007-70,3 |
|
224-052-0 |
|
- |
|
4301 |
|
- |
|
148.2 |
|
1-methoxy-4-[(E)-prop-1-enyl]benzene |
|
1-methoxy-4-[(E)-prop-1-enyl]benzene |
|
- |
|
- |
|
- |
|
Not applicable |
|
Not applicable |
|
None |
|
Not applicable |
|
- |
|
A natural botanical oil which is olourless to pale yellow, with strong characteristic odour. The oil is a complex mix of botanical substances but which is dominated (~90%) by anethol. |
|
|
|
|
|
|
- |
- |
|
Supplied in liquid form including as a ready-to-use spray for use as a cat/dog or insect repellent |
|
|
|
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
83.3 |
(closed cup) |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
0.98 |
|
- |
|
- |
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
Soil adsorption and mobility |
|
None
Terrestrial ecotoxicology |
|
|
|
|
|
2250 |
Rat |
Low |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
316 |
Unknown species |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
> 1000 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Expert judgement |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
> 100 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Expert judgement |
Low |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
Anethole: High (class III) |
- |
- |
|
2250 |
Rat |
Low |
|
5000 |
Rabbit |
- |
|
- |
- |
- |
|
Intraperitoneal LD₅₀ = 593 mg kg⁻¹ |
Mouse anethole |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E2 E = Unspecified genotoxicity type (miscellaneous data source) 2 = Mixed/ambiguous results |
XNo, known not to cause a problem |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
?Possibly, status not identified |
✓Yes, known to cause a problem |
?Possibly, status not identified |
Eye irritant |
Phototoxicant |
  |
✓Yes, known to cause a problem |
No data found |
  |
|
|
May cause gastrointestinal tract irritation |
|
|
|
No information available |
|
- |
|
Not listed (Not listed) |
|
- |
|
- |
|
- |
|
|
|
anethole |
|
- |
|
Anis oel |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
Record last updated: |
12/06/2024 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |