Star anise oil |
Last updated: 26/06/2024
|
|
(Also known as: oil of star anise; Illicium verum fruit oil; Chinese star anise; Star aniseed) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
  |
|
|
|
A natural plant extract with a variety of uses including as a repellent of cats, dogs, fleas, lice and ticks |
|
Cats; Dogs; Fleas; Tticks; Lice; Flying insects |
|
Domestic gardens; Leisure/public gardens; Herbaceous plants; Lawns |
|
- |
|
- |
|
Current |
|
1952, first registered, USA; 1993, reregistered, USA |
|
Class: Magnoliopsida; Order: Austrobaileyales; Family: Schisandraceae |
|
Not approved |
|
Not applicable |
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
No |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
  |
  |
  |
  |
  |
  |
  |
  |
  |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
  |
  |
  |
  |
  |
  |
  |
  |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
  |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
  |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
Anethole, a component of star anise oil, is isomeric |
|
C₁₀H₁₂O (anethole) |
|
Anethole: CC=CC1=CC=C(C=C1)OC |
|
Anethole: C/C=C/C1=CC=C(C=C1)OC |
|
Anethole: RUVINXPYWBROJD-ONEGZZNKSA-N |
|
Anethole: InChI=1S/C10H12O/c1-3-4-9-5-7-10(11-2)8-6-9/h3-8H,1-2H3/b4-3 |
|
Yes |
|
Insecticide, Miticide, Other substance, Semiochemical |
|
Flavouring, Purfumery |
|
Plant-derived substance; Plant oil |
|
- |
|
- |
|
Natural; Complex mixture |
|
Broad spectrum, repellent and contact action. |
|
A plant oil derived from Star anise (Illicium verum) which is a small evergreen shrub native to China used as a spice. |
|
Produced commerical using a steam distillation process using crushed plant seeds |
|
Mammal repellent; Insect repellent |
|
Cats; Dogs; Fleas; Tticks; Lice; Flying insects |
|
Domestic gardens; Leisure/public gardens; Herbaceous plants; Lawns |
|
- |
|
64650-59-9 |
|
104-46-1 (anethole) |
|
283-872-7 |
|
- |
|
4301 |
|
- |
|
148.2 |
|
star anise oil |
|
- |
|
- |
|
- |
|
FEMA=2096 |
|
- |
|
Not applicable |
|
Not applicable |
|
None |
|
Not applicable |
|
- |
|
A botanical oil which is colourless to pale yellow, with strong characteristic odour. The oil is a complex mix of botanical substances but which is dominated (~87%) by anethol. |
|
|
|
|
|
|
- |
- |
|
Supplied in liquid form including as a ready to use spray for use as a cat/dog or insect repellent |
|
|
|
|
|
- |
- |
- |
|
- |
- |
- |
|
16.5 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source |
- |
|
- |
- |
- |
|
- |
- |
- |
|
83.3 |
(closed cup) |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
0.98 |
|
- |
|
- |
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
- |
Soil adsorption and mobility |
|
None
Terrestrial ecotoxicology |
|
|
|
|
|
2250 |
Rat |
Low |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
> 5000 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Unknown species |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
> 1000 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Expert judgement |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
> 100 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Expert judgement |
Low |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
> 100 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Unknown species |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
Anethole: High (class III) |
- |
- |
|
2250 |
Rat |
Low |
|
5000 |
Rabbit |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E2 E = Unspecified genotoxicity type (miscellaneous data source) 2 = Mixed/ambiguous results |
XNo, known not to cause a problem |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
?Possibly, status not identified |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
Eye irritant |
Phototoxicant |
  |
✓Yes, known to cause a problem |
No data found |
  |
|
|
May cause gastrointestinal tract irritation Possible kidney toxicant |
|
|
|
Combustible IMDG Transport Hazard Class 9 |
|
- |
|
Not listed (Not listed) |
|
UN3082 |
|
Packaging Group III (minor danger) |
|
- |
|
|
|
star anise oil |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
Record last updated: |
26/06/2024 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |