| Spearmint oil |

Last updated: 14/02/2026
|
 |
(Also known as: p-mentha-6,8-dien-2-one; d-carvone) |
The following Pesticide Hazard Tricolour (PHT) alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement. The alerts for Highly Hazardous Pesticides (HHPs) are based on applying the FAO/WHO (Type 1) and the PAN (Type II) criteria to PPDB data. Further details on the HHP indicators are given in the tables below. Neither the PHT nor the HHP hazard alerts take account of usage patterns or exposure, thus they do not represent risk.
| PHT: Environmental fate |
PHT: Ecotoxicity |
PHT: Human health |
Highly Hazardous Pesticide |
|   |
|
|
  |
|
|
A fungicide, insecticide and plant growth regulator often used as a potato sprouting inhibitor |
|
|
Storage pests; Spider mites (Tetranychus urticae); Houseflies (Musca domestica); Growth |
|
|
Potatoes |
|
|
- |
|
|
- |
|
|
Class: Magnoliopsida; Order: Lamiales; Family: Lamiaceae |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Approved |
|
|
Sweden/Netherlands |
|
|
31/01/2026 |
|
|
No |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| ✓ |
✓ |
✓ |
  |
  |
✓ |
✓ |
  |
✓ |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| ✓ |
✓ |
✓ |
✓ |
  |
✓ |
✓ |
✓ |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|   |
  |
✓ |
  |
✓ |
✓ |
✓ |
  |
  |
|
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
|   |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
|
Spearmint oil contains several compounds that exhibit stereoisomerism, most notably carvone, which exists as two enantiomers: (R)-carvone and (S)-carvone. Spearmint oil is rich in (R)-carvone, which gives it its characteristic sweet, minty aroma. This enantiomeric form differs from (S)-carvone found in caraway oil, which smells spicy and earthy. |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
Major consitituent: InChI=1S/C10H14O/c1-7(2)9-5-4-8(3)10(11)6-9/h4,9H,1,5-6H2,2-3H3 |
|
|
Yes |
|
|
Plant Growth Regulator; Insecticide; Metabolite; Other substance |
|
|
Soil; Groundwater |
|
|
Antimicrobial |
|
|
Plant-derived substance; Plant oil |
|
|
- |
|
|
EU dossier - none declared |
|
|
Natural; Complex mixture |
|
|
Works primarily through a non-toxic mode of action as a repellent but also thought to inhibit cell growth |
|
|
Plant oil dervived primarily from the Mentha spicata plant |
|
|
The composition of spearmint oil is dominated carvone (50-70%), a monoterpenoid ketone that defines its aroma and biological activity. The rest of the oil consists of monoterpenes and oxygenated terpenes including limonene (10-20%), 1,8 Cineole (1-5%), beta myrcene (1-3%), alpha-pinene (0.5-1.0%), beta-pinene (0.5-2%) and various oxygenated terpenes (2-10%) |
|
|
Post harvest management; Crop protection; Domestic pest control |
|
|
- |
|
|
8008-79-5 |
|
|
283-656-2 (spearmint extract) |
|
|
908 |
|
|
128800 |
|
|
- |
|
|
- |
|
|
spearmint oil |
|
|
- |
|
|
- |
|
|
- |
|
|
| UK Poisons List Order 1972 |
Rotterdam Convention |
Montreal Protocol |
|
|
|
| Stockholm Convention |
OSPAR |
EU Water Framework Directive |
|
|
|
|
|
|
- |
|
|
- |
|
|
|
- |
|
|
- |
|
|
FEMA=3032; FLAVIS=04.134 |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
- |
|
|
Colourless to pale yellow/green liquid which is comprised of a complex mixture of botanical substances including L-carvone (~67%), D-limonene (~14%), |
|
|
|
|
|
|
|
|
Current |
|
|
1966, first listed for plant protection |
|
|
- Silverline Chemicals, India
- Arora Aromatics
- VedaOils UK
|
|
|
- Mentha Spicata Oil
- MintGuard
- Natural Spearmint Oil
|
|
|
Usually supplied in formulations for hot fogging for indoor use only |
|
|
Commercial production of spearmint oil begins with the cultivation of Mentha spicata. The leaves are harvested at peak potency, often during summer, using careful methods to preserve oil quality. The most common extraction technique is steam distillation, where steam passes through the leaves to release volatile compounds, which are then condensed and separated from water to yield the oil. Some producers also use solvent extraction for specialised applications. |
|
|
Data for specific plant oils is scarce. However, from publicly available data the carbon footprint of plant oils has been estimated at between 1.0 and 4.0 kg CO₂e per kg of oil. This depends on the plant oil content, agricultural practices and processing methods used. |
|
|
|
|
|
|
|
|
|
|
1300 |
at 25 °C |
High |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
230 |
|
- |
|
|
- |
- |
- |
|
|
92.0 |
|
- |
|
|
|
2.51 X 1002 |
Calculated |
- |
|
|
2.4 |
|
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.957 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
| - |
|
|
21328 |
at 25 °C |
Highly volatile. If applied directly to plants or soil, drift is a concern & mitigation is advisable |
|
|
7.83 |
at 25 °C |
Moderately volatile |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
31.13 |
|
- |
|
|
|
|
|
|
|
- |
|
|
|
30 |
Carvone |
Moderately persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
|
- |
| Soil adsorption and mobility |
|
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
> 2000 |
Rat |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 1000 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source Eisenia foetida |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
> 200 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
- |
- |
- |
|
|
- |
|
|
|
|
|
|
|
> 20.3 |
Oncorhynchus mykiss as carvone |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 9.59 |
Daphnia magna as carvone |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
4.58 |
Unknown species as carvone |
Moderate |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
| Regulatory Threshold Levels (RTLs) |
|
Note: These RTLs have been calculated using the regulatory approach used in the European Union and based on ecotoxocity values in the PPDB.
|
|
|
|
|
|
200 |
Worst case of acute and chronic mammals |
|
|
No data |
No data for acute and chronic birds |
|
|
100 |
Worst case of acute and chronic earthworms |
|
|
No data |
No data for non-target plants vegetative vigour and seedling emergence |
|
|
4 |
Worst case of contact and oral honeybees |
|
|
No data |
No data for parasitic wasps and predatory mites |
|
|
0.203 |
Worst case of temperate acute and chronic fish |
|
|
0.0959 |
Worst case of temperate acute and chronic aquatic invertebrates |
|
|
0.458 |
Worst case of free-floating plants, rooted plants, acute and chronic algae |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
|
Intermediate (class II) |
- |
- |
|
|
> 2000 |
Rat |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 2000 |
Rat |
- |
|
|
> 5.43 |
Rat |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
XNo, known not to cause a problem |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
?Possibly, status not identified |
?Possibly, status not identified |
| Eye irritant |
Phototoxicant |
  |
?Possibly, status not identified |
No data found |
  |
|
|
|
May cause gastrointestinal tract irritation with nausea, vomiting and diarrhoea |
|
|
|
|
|
Not explosve or oxidising |
|
|
Health: H304, H317 |
|
|
Not listed |
|
|
- |
|
|
- |
|
|
Volatile — store in an airtight container |
|
|
|
|
|
spearmint oil |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
| Record last updated: |
14/02/2026 |
| Contact: |
aeru@herts.ac.uk |
| Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |
© Copyright University of Hertfordshire, 2006-2026. All Rights Reserved
Your use of this website and its various databases is subject to the terms detailed in the University of Hertfordshire’s copyright and IPR statement that can be found at
https://www.herts.ac.uk/about-us/legal.
In addition, your use of this website and its various databases is subject to the terms of this additional Copyright Statement and the database
Conditions of use document.
Unless explicitly stated otherwise, the content of this website and databases are owned and controlled by the University of Hertfordshire. Site content, including its selection and arrangement, is owned by the University of Hertfordshire and is protected by copyright and other laws.
Except as otherwise expressly permitted under copyright law or within the database Conditions of Use document, the content of this site may not be copied, reproduced, republished, downloaded, posted, broadcast or transmitted in any way without first obtaining the University of Hertfordshire’s written permission.
By using our databases the user is deemed to have agreed to comply with all of the terms and conditions as described above and within all relevant documentation.