Nornicotine |
![](images/calendar_bpdb.png)
Last updated: 23/05/2024
|
![](images/BPDB_logo_64.png) |
(Also known as: dimethylnicotine) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
|
|
|
Plant alkaloid related to nicotine (metabolite) that can be used to control various soft-bodied insect pests |
|
Aphids including Green peach aphid; Thrips; Mealy bugs |
|
Beans; Spinach; Turnips; Top fruit; Vegetables; Grapes; Protected ornamentals |
|
- |
|
- |
|
Current |
|
- |
|
- |
|
Not approved |
|
Not applicable |
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
No |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
  |
  |
  |
  |
  |
  |
  |
  |
  |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
  |
  |
  |
  |
  |
  |
  |
  |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
  |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
  |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
Nornicotine is a chiral molecule with Absolute stereochemistry |
|
C₉H₁₂N₂ |
|
C1CC(NC1)C2=CN=CC=C2 |
|
C1C[C@H](NC1)C2=CN=CC=C2 |
|
MYKUKUCHPMASKF-VIFPVBQESA-N |
|
InChI=1S/C9H12N2/c1-3-8(7-10-5-1)9-4-2-6-11-9/h1,3,5,7,9,11H,2,4,6H2/t9-/m0/s1 |
|
Yes |
|
Insecticide, Metabolite |
|
Soil |
|
Plant-derived substance |
|
- |
|
- |
|
Natural |
|
Broad spectrum and fast acting. Mainly respiratory action but some contact and stomach activity |
|
Isolated from tobacco plants (Nicotiana tabacum) and from other plants including those belonging to the Lycopodiaceae, Grassulaceae & Leguminosae families |
|
Manufactured for crop protection applications. |
|
Crop protection |
|
Aphids including Green peach aphid; Thrips; Mealy bugs |
|
Beans; Spinach; Turnips; Top fruit; Vegetables; Grapes; Protected ornamentals |
|
- |
|
494-97-3 |
|
621-530-4 |
|
None allocated |
|
- |
|
412 |
|
No data found |
|
148.20 |
|
3-[(2S)-pyrrolidin-2-yl]pyridine |
|
3-[(2S)-pyrrolidin-2-yl]pyridine |
|
3-(2S)-2-pyrrolidinylpyridine |
|
- |
|
- |
|
Not applicable |
|
Not applicable |
|
4B |
|
Not applicable |
|
- |
|
Yellow coloured viscous liquid with amine type odour |
|
|
|
|
|
50 |
|
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
270 |
|
- |
|
- |
- |
- |
|
213.8 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source |
- |
|
|
1.48 X 1000 |
Calculated |
- |
|
0.17 |
|
Low |
|
|
- |
- |
- |
|
- |
- |
- |
|
1.074 |
|
- |
|
5.25 |
|
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
Does not absort at wavelengths >290nm |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
4.2 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
Mustard leaves, n=1 |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Moderately mobile |
|
250 |
|
Literature estimates of Koc range 14-500 mL g⁻¹ |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
> 21.7 |
Mouse |
High |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
> 10 |
Eisenia foetida |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
> 21.7 |
Mouse |
High |
|
- |
- |
- |
|
- |
- |
- |
|
Intravenous LD₅₀ = 3.41 mg kg⁻¹ |
Mouse |
- |
Intraperitoneal LD₅₀ = 14.66 mg kg⁻¹ |
Mouse |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
?Possibly, status not identified |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E2 E = Unspecified genotoxicity type (miscellaneous data source) 2 = Mixed/ambiguous results |
XNo, known not to cause a problem |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
?Possibly, status not identified |
XNo, known not to cause a problem |
✓Yes, known to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
No data found |
Eye irritant |
Phototoxicant |
  |
✓Yes, known to cause a problem |
No data found |
  |
|
|
Very toxic by inhalation and ingestion - may be fatal Nicotinic exposure may cause various adverse health effects A precursor to the carcinogen N -nitrosonornicotine |
|
|
|
Hygroscopic |
|
Health: H302, H312, H315, H319, H332, H335 |
|
Not listed (Not listed) |
|
- |
|
Packaging Group III (minor danger) |
|
Chemically stable under standard ambient conditions in the absence of moisture |
|
|
|
nornicotine |
|
nornicotine |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
Record last updated: |
23/05/2024 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |