Piperine (black pepper dust) |

Last updated: 28/07/2025
|
 |
(Also known as: Piperoylpiperidine; Pepper) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
  |
|
|
|
A plant derived, humane, deterrent which animals from digging, scratching and fouling outside spaces. The main active substance is piperine. |
|
Damaging mammals |
|
Cats; Dogs; Deer; Rabbits |
|
- |
|
- |
|
Current |
|
- |
|
Class: Magnoliopsida; Order: Piperales; Family: Piperaceae |
|
Not approved |
|
Not applicable |
|
No UK approval for use as a plant protection agent |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
- |
|
Not applicable |
|
No |
|
No |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
  |
  |
  |
  |
  |
  |
  |
  |
  |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
  |
  |
  |
  |
  |
  |
  |
  |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
  |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
  |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
Isomeric |
|
C₁₇H₁₉NO₃ |
|
C1CCN(CC1)C(=O)C=CC=CC2=CC3=C(C=C2)OCO3 |
|
C1CCN(CC1)C(=O)/C=C/C=C/C2=CC3=C(C=C2)OCO3 |
|
MXXWOMGUGJBKIW-YPCIICBEBY |
|
InChI=1/C17H19NO3/c19-17(18-10-4-1-5-11-18)7-3-2-6-14-8-9-15-16(12-14)21-13-20-15/h2-3,6-9,12H,1,4-5,10-11,13H2/b6-2+,7-3+ |
|
Yes |
Cambridge Crystallographic Data Centre diagrams |
|
|
Common Name |
Relationship |
Link |
piperine (black pepper dust) |
- |
 |
|
Semiochemical |
|
Plant-derived substance |
|
- |
|
- |
|
Natural |
|
Acts as a repellent |
|
Oroduced from the still-green, unripe drupe of the black pepper plant (Piper nigrum) |
|
Dried seed husks from Piper nigrum are ground |
|
Crop protection |
|
Damaging mammals |
|
Cats; Dogs; Deer; Rabbits |
|
- |
|
94-62-6 |
|
7780-20-3 |
|
- |
|
- |
|
- |
|
553590 |
|
285.34 |
|
(2E,4E)-5-(2H-1,3-Benzodioxol-5-yl)-1-(piperidin-1-yl)penta-2,4-dien-1-one |
|
(2E,4E)-5-(1,3-benzodioxol-5-yl)-1-piperidin-1-ylpenta-2,4-dien-1-one |
|
- |
|
- |
|
Available in many countries as a basic or commodity substance; US GRAS, widely used in food stuffs |
|
- |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
- |
|
Brown powder |
|
|
|
|
|
|
Pepper dust animal repellent |
Vitax Ltd |
Pepper dust animal repellent |
Bayer Crop Protection |
|
Usually marketed in ready-to-use formulations |
|
|
|
|
|
40 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Moderate |
|
- |
- |
- |
|
130 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
Decomposes before boiling |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
1.193 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
- |
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
- |
Soil adsorption and mobility |
|
None
Terrestrial ecotoxicology |
|
|
|
|
|
> 2000 |
E4 E = Manufacturers safety data sheets 4 = Verified data Rat |
Low |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
> 100 |
E4 E = Manufacturers safety data sheets 4 = Verified data Unknown species |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
> 100 |
E4 E = Manufacturers safety data sheets 4 = Verified data Unknown species |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
> 100 |
E4 E = Manufacturers safety data sheets 4 = Verified data Unknown species |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
- |
- |
- |
|
> 2000 |
E4 E = Manufacturers safety data sheets 4 = Verified data Rat |
Low |
|
2000 |
E4 E = Manufacturers safety data sheets 4 = Verified data Rat |
- |
|
> 5.0 |
E4 E = Manufacturers safety data sheets 4 = Verified data Rat 4 hr |
- |
|
- |
- |
- |
|
None allocated |
E4 E = Manufacturers safety data sheets 4 = Verified data |
- |
|
None allocated |
E4 E = Manufacturers safety data sheets 4 = Verified data |
- |
|
None allocated |
E4 E = Manufacturers safety data sheets 4 = Verified data |
- |
|
None allocated |
E4 E = Manufacturers safety data sheets 4 = Verified data |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
No data found |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
No data found |
No data found |
No data found |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
?Possibly, status not identified |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
Eye irritant |
Phototoxicant |
  |
?Possibly, status not identified |
XNo, known not to cause a problem |
  |
|
|
No information available |
|
|
|
Not oxidising or explosive |
|
- |
|
Not listed (Not listed) |
|
Not regulated |
|
- |
|
- |
|
|
|
piperine (black pepper dust) |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
Record last updated: |
28/07/2025 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |