| 1-naphthylacetic acid sodium salt |

Last updated: 04/02/2026
|
 |
(Also known as: Na-NAA) |
The following Pesticide Hazard Tricolour (PHT) alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement. The alerts for Highly Hazardous Pesticides (HHPs) are based on applying the FAO/WHO (Type 1) and the PAN (Type II) criteria to PPDB data. Further details on the HHP indicators are given in the tables below. Neither the PHT nor the HHP hazard alerts take account of usage patterns or exposure, thus they do not represent risk.
| PHT: Environmental fate |
PHT: Ecotoxicity |
PHT: Human health |
Highly Hazardous Pesticide |
|   |
|
|
  |
|
|
A synthetic auxin salt used as a plant growth regulator to control top fruit pre-harvest fruit drop, for fruitlet thinning and for striking hard and softwood cuttings. Also a metabolite. |
|
|
Growth - reduces fruit drop |
|
|
Top fuit including apples, pears, plums, cherries; Potatoes |
|
|
- |
|
|
- |
|
|
- |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Approved |
|
|
Hungary/France |
|
|
31/05/2026 |
|
|
No |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| ✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
  |
  |
✓ |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| ✓ |
  |
✓ |
✓ |
  |
✓ |
✓ |
✓ |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| ✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
  |
✓ |
✓ |
|
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
|   |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
|
None |
|
|
C₁₂H₉NaO₂ |
|
|
C1=CC=C2C(=C1)C=CC=C2CC(=O)[O-].[Na+] |
|
|
- |
|
|
CJUUXVFWKYRHAR-UHFFFAOYSA-M |
|
|
InChI=1S/C12H10O2.Na/c13-12(14)8-10-6-3-5-9-4-1-2-7-11(9)10;/h1-7H,8H2,(H,13,14);/q;+1/p-1 |
|
|
Yes |
| Cambridge Crystallographic Data Centre diagrams |
|
|
| Common Name |
Relationship |
Link |
| 1-naphthylacetic acid |
Paraent |
 |
|
|
Plant Growth Regulator |
|
|
Soil; Groundwater |
|
|
Auxin PGR; Naphthalene compound |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Absorbed through roots, stems and leaves, demonstrates auxin-like activity |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
61-31-4 |
|
|
200-504-2 |
|
|
313 |
|
|
- |
|
|
23694671 |
|
|
208.18 |
|
|
- |
|
|
sodium; 2-naphthalen-1-ylacetate |
|
|
1-naphthylacetic acid, sodium salt |
|
|
| UK Poisons List Order 1972 |
Rotterdam Convention |
Montreal Protocol |
|
|
|
| Stockholm Convention |
OSPAR |
EU Water Framework Directive |
|
|
|
|
|
|
- |
|
|
- |
|
|
|
- |
|
|
- |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
- |
|
|
- |
|
|
|
|
|
|
|
|
Current |
|
|
1939, acid first reported; Circa 1960, introduced |
|
|
- Hebei Senton
- Lemandou Chemicals
- Runtai Chemical
|
|
|
- Fruitone N
- Planofix
- Stik
- Amcotone
|
|
|
Usually supplied as wettable powders, soluble concentrates and dustable powders |
|
|
Commercial production of 1 naphthylacetic acid sodium salt follows the same fine chemical manufacturing route used for its parent compound, 1 naphthylacetic acid. Industrial synthesis begins with preparation of the naphthalene based acetic acid intermediate, which is then neutralised with sodium hydroxide under controlled aqueous or mixed solvent conditions to form the sodium salt. |
|
|
- |
|
|
|
|
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
|
- |
| Soil adsorption and mobility |
|
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
> 1750 |
Rat as NAA acid |
Moderate |
|
|
10 |
Rat 90-day as NAA acid |
Moderate |
|
|
43.8 |
Rat 2-yr |
Moderate |
|
|
> 2510 |
Coturnix japonica as NAA acid |
Low |
|
|
> 1606 |
Coturnix japonica as NAA acid |
- |
|
|
- |
- |
- |
|
|
> 1000 |
Eisenia foetida as NAA acid |
Low |
|
|
- |
- |
- |
|
|
Nitrogen mineralisation: No significant adverse effect Carbon mineralisation: No significant adverse effect |
0.1 mg kg⁻¹ 1-NAA |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
> 96.7 |
Apis mellifera |
Moderate |
|
|
> 78.6 |
Apis mellifera |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
- |
- |
- |
|
|
- |
|
|
|
|
|
|
|
> 56 |
Oncorhynchus mykiss as NAA acid |
Moderate |
|
|
10 |
Oncorhynchus mykiss as NAA acid |
Moderate |
|
|
- |
- |
- |
|
|
> 56 |
Daphnia magna as NAA acid |
Moderate |
|
|
> 22 |
Daphnia magna as NAA acid |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
5.09 |
Lemna gibba as NAA acid |
Moderate |
|
|
- |
- |
- |
|
|
26.62 |
Raphidocelis subcapitata as NAA acid |
Low |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
| Regulatory Threshold Levels (RTLs) |
|
Note: These RTLs have been calculated using the regulatory approach used in the European Union and based on ecotoxocity values in the PPDB.
|
|
|
|
|
|
2 |
Worst case of acute and chronic mammals |
|
|
251 |
Worst case of acute and chronic birds |
|
|
200 |
Worst case of acute and chronic earthworms |
|
|
No data |
No data for non-target plants vegetative vigour and seedling emergence |
|
|
1.572 |
Worst case of contact and oral honeybees |
|
|
No data |
No data for parasitic wasps and predatory mites |
|
|
0.56 |
Worst case of temperate acute and chronic fish |
|
|
0.56 |
Worst case of temperate acute and chronic aquatic invertebrates |
|
|
0.509 |
Worst case of free-floating plants, rooted plants, acute and chronic algae |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
> 1750 |
Rat as NAA acid |
Moderate |
|
|
10 |
Rat 90-day as NAA acid |
Moderate |
|
|
43.8 |
Rat 2-yr |
Moderate |
|
|
> 2000 |
Rat |
- |
|
|
> 0.45 |
Rat (whole body) as NAA acid |
- |
|
|
- |
- |
- |
|
|
0.10 |
Rat SF=150 as NAA acid |
- |
|
|
0.10 |
Rat SF=150 as NAA acid |
- |
|
|
- |
- |
- |
|
|
0.07 |
Rat SF=170 as NAA acid |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
Acceptable risk for proposed uses |
|
|
PPE/PPC advised to mitigate exposure risks |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C3 C = Gene mutation (EFSA database) 3 = Negative ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
XNo, known not to cause a problem |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
✓Yes, known to cause a problem |
XNo, known not to cause a problem |
No data found |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
XNo, known not to cause a problem |
| Eye irritant |
Phototoxicant |
  |
✓Yes, known to cause a problem |
No data found |
  |
|
|
|
Possible blood toxicant |
|
|
|
|
|
Not explosive or oxidising Not expected to auto-ignite; Not highly flammable |
|
|
Health: H302, H315, H318, H319. H335 Environment: H412 |
|
|
III (Slightly hazardous) |
|
|
- |
|
|
- |
|
|
Limited shelf-life. Store in a cool and dry place |
|
|
|
|
|
1-naphthylacetic acid sodium salt |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
| Record last updated: |
04/02/2026 |
| Contact: |
aeru@herts.ac.uk |
| Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |
© Copyright University of Hertfordshire, 2006-2026. All Rights Reserved
Your use of this website and its various databases is subject to the terms detailed in the University of Hertfordshire’s copyright and IPR statement that can be found at
https://www.herts.ac.uk/about-us/legal.
In addition, your use of this website and its various databases is subject to the terms of this additional Copyright Statement and the database
Conditions of use document.
Unless explicitly stated otherwise, the content of this website and databases are owned and controlled by the University of Hertfordshire. Site content, including its selection and arrangement, is owned by the University of Hertfordshire and is protected by copyright and other laws.
Except as otherwise expressly permitted under copyright law or within the database Conditions of Use document, the content of this site may not be copied, reproduced, republished, downloaded, posted, broadcast or transmitted in any way without first obtaining the University of Hertfordshire’s written permission.
By using our databases the user is deemed to have agreed to comply with all of the terms and conditions as described above and within all relevant documentation.