1-naphthylacetic acid sodium salt |

Last updated: 06/08/2025
|
 |
(Also known as: Na-NAA) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement. These hazard alerts do not take account of usage patterns or exposure, thus do not represent risk.
Environmental fate |
Ecotoxicity |
Human health |
  |
|
|
|
A synthetic auxin salt used as a plant growth regulator to control top fruit pre-harvest fruit drop, for fruitlet thinning and for striking hard and softwood cuttings. Also a metabolite. |
|
Growth - reduces fruit drop |
|
Top fuit including apples, pears, plums, cherries; Potatoes |
|
- |
|
- |
|
- |
EC Regulation 1107/2009 (repealing 91/414) |
|
Approved |
|
Hungary/France |
|
31/05/2026 |
|
No |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
  |
  |
✓ |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
✓ |
  |
✓ |
✓ |
  |
✓ |
✓ |
✓ |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
  |
✓ |
✓ |
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
  |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
None |
|
C₁₂H₉NaO₂ |
|
C1=CC=C2C(=C1)C=CC=C2CC(=O)[O-].[Na+] |
|
- |
|
CJUUXVFWKYRHAR-UHFFFAOYSA-M |
|
InChI=1S/C12H10O2.Na/c13-12(14)8-10-6-3-5-9-4-1-2-7-11(9)10;/h1-7H,8H2,(H,13,14);/q;+1/p-1 |
|
Yes |
Cambridge Crystallographic Data Centre diagrams |
|
|
Common Name |
Relationship |
Link |
1-naphthylacetic acid |
Paraent |
 |
|
Plant Growth Regulator |
|
Soil; Groundwater |
|
Auxin PGR; Naphthalene compound |
|
- |
|
- |
|
Synthetic |
|
Absorbed through roots, stems and leaves, demonstrates auxin-like activity |
|
- |
|
- |
|
- |
|
- |
|
- |
|
61-31-4 |
|
200-504-2 |
|
313 |
|
- |
|
23694671 |
|
208.18 |
|
- |
|
sodium; 2-naphthalen-1-ylacetate |
|
1-naphthylacetic acid, sodium salt |
|
- |
|
- |
|
- |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
- |
|
- |
|
|
|
|
|
Current |
|
1939, acid first reported; Circa 1960, introduced |
|
- |
|
- |
|
Usually supplied as wettable powders, soluble concentrates and dustable powders |
|
- |
|
- |
|
|
|
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
- |
Soil adsorption and mobility |
|
None
Terrestrial ecotoxicology |
|
|
|
|
|
> 1750 |
Rat as NAA acid |
Moderate |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
> 2510 |
Coturnix japonica as NAA acid |
Low |
|
> 1606 mg kg bw⁻¹ day⁻¹ |
Coturnix japonica as NAA acid |
- |
|
- |
- |
- |
|
> 1000 |
Eisenia foetida as NAA acid |
Low |
|
- |
- |
- |
|
Nitrogen mineralisation: No significant adverse effect Carbon mineralisation: No significant adverse effect |
0.1 mg kg⁻¹ 1-NAA |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
> 96.7 |
Apis mellifera |
Moderate |
|
> 78.6 |
Apis mellifera |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
> 56 |
Oncorhynchus mykiss as NAA acid |
Moderate |
|
10 |
Oncorhynchus mykiss as NAA acid |
Moderate |
|
- |
- |
- |
|
> 56 |
Daphnia magna as NAA acid |
Moderate |
|
> 22 |
Daphnia magna as NAA acid |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
5.09 |
Lemna gibba as NAA acid |
Moderate |
|
- |
- |
- |
|
26.62 |
Raphidocelis subcapitata as NAA acid |
Low |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
> 1750 |
Rat as NAA acid |
Moderate |
|
2000 |
Rat |
- |
|
> 0.45 |
Rat (whole body) as NAA acid |
- |
|
- |
- |
- |
|
0.10 |
Rat SF=150 as NAA acid |
- |
|
0.10 |
Rat SF=150 as NAA acid |
- |
|
- |
- |
- |
|
0.07 |
Rat SF=170 as NAA acid |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
Acceptable risk for proposed uses |
|
PPE/PPC advised to mitigate exposure risks |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C3 C = Gene mutation (EFSA database) 3 = Negative ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
XNo, known not to cause a problem |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
✓Yes, known to cause a problem |
XNo, known not to cause a problem |
No data found |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
XNo, known not to cause a problem |
Eye irritant |
Phototoxicant |
  |
✓Yes, known to cause a problem |
No data found |
  |
|
|
Possible blood toxicant |
|
|
|
Not explosive or oxidising Not expected to auto-ignite; Not highly flammable |
|
Health: H302, H315, H318, H319. H335 Environment: H412 |
|
III (Slightly hazardous) |
|
- |
|
- |
|
Limited shelf-life. Store in a cool and dry place |
|
|
|
1-naphthylacetic acid sodium salt |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
Record last updated: |
06/08/2025 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |