| Citral |

Last updated: 21/02/2026
|
 |
(Also known as: geranialdehyde) |
The following Pesticide Hazard Tricolour (PHT) alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement. The alerts for Highly Hazardous Pesticides (HHPs) are based on applying the FAO/WHO (Type 1) and the PAN (Type II) criteria to PPDB data. Further details on the HHP indicators are given in the tables below. Neither the PHT nor the HHP hazard alerts take account of usage patterns or exposure, thus they do not represent risk.
| PHT: Environmental fate |
PHT: Ecotoxicity |
PHT: Human health |
Highly Hazardous Pesticide |
|
|
|
  |
|
|
A plant-derived substance common in many essential oils and which demonstrates insecticidal, fungicide, antimicrobial and herbicidal activities |
|
|
Spider mite (Tetranychus urticae); General insect eggs & larvae; Housedust mites; Postharvest fungal pathogens including moulds & rots; Blister blight fungus (Exobasidium vexans) |
|
|
Post-harvest food preparation; Citrus; Tea |
|
|
- |
|
|
- |
|
|
- |
|
|
Not approved |
|
|
Not applicable |
|
|
No UK approval for use as a pest management agent |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
No |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
|   |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
|
Citral exists as a mixture of two geometric isomers: geranial (trans-citral or E-isomer, approximately 60-70% in natural sources) and neral (cis-citral or Z-isomer, approximately 30-40%). |
|
|
C₁₀H₁₆O |
|
|
CC(=CCC/C(=C/C=O)/C)C |
|
|
- |
|
|
WTEVQBCEXWBHNA-JXMROGBWSA-N |
|
|
InChI=1S/C10H16O/c1-9(2)5-4-6-10(3)7-8-11/h5,7-8H,4,6H2,1-3H3/b10-7+ |
|
|
Yes |
|
|
Insecticide; Herbicide; Fungicide; Antimicrobal; Other substance |
|
|
Flavouring; Fragrance |
|
|
Monoterpenoid aldehyde; Plant-derived substance |
|
|
- |
|
|
- |
|
|
Natural |
|
|
Inhibits bacteria and fungi by disrupting cell membranes |
|
|
It occurs naturally in essential oils from plants such as lemongrass (up to 75%), verbena, lemon (2-5%), lime (6-9%), orange, litsea cubeba (70%), backhousia citriodora (85-97%), and others |
|
|
Crop and harvest protection |
|
|
Spider mite (Tetranychus urticae); General insect eggs & larvae; Housedust mites; Postharvest fungal pathogens including moulds & rots; Blister blight fungus (Exobasidium vexans) |
|
|
Post-harvest food preparation; Citrus; Tea |
|
|
- |
|
|
5392-40-5 |
|
|
205-476-5 |
|
|
- |
|
|
- |
|
|
638011 |
|
|
152.23 |
|
|
(2E)-3,7-dimethylocta-2,6-dienal |
|
|
(2E)-3,7-dimethylocta-2,6-dienal |
|
|
3,7-dimethyl-2,6-octadienal |
|
|
| UK Poisons List Order 1972 |
Rotterdam Convention |
Montreal Protocol |
|
|
|
| Stockholm Convention |
OSPAR |
EU Water Framework Directive |
|
|
|
|
|
|
- |
|
|
- |
|
|
|
- |
|
|
- |
|
|
FEMA=2303 |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
- |
|
|
A clear yellow coloured liquid with a lemon-like odour |
|
|
|
|
|
|
|
|
Current |
|
|
1948, first registration US |
|
|
|
|
|
- |
|
|
- |
|
|
Citral is commercially produced on a large scale through synthetic routes.The key intermediate is isoprenol (3-methyl-3-buten-1-ol), formed by addition of formaldehyde to isobutene. Isoprenol undergoes oxidative dehydrogenation (often over silver catalysts) to yield a mixture of prenal and related compounds, followed by isomerisation steps to prenol and prenal. These react under acidic catalysis to form an unsaturated acetal, which then undergoes thermal cleavage and rearrangement to produce citral as a roughly 1:1 mixture of geranial (E-isomer) and neral (Z-isomer). Historically and to a lesser extent today, natural citral is extracted by steam distillation or fractionation from essential oils of plants. |
|
|
- |
|
|
|
|
|
|
|
|
|
|
1340 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source at 25 °C |
High |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
92 |
|
- |
|
|
- |
- |
- |
|
|
82 |
(closed cup) |
- |
|
|
|
7.41 X 1002 |
Calculated |
- |
|
|
2.87 |
|
Moderate |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.891 |
|
- |
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
Readily biodegradable |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
|
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
estimated |
Moderately mobile |
|
|
83 |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
| Known soil and groundwater metabolites |
|
None
|
|
|
|
|
| 3-hydroxy-3,7-dimethyl-6-octenedioic acid |
- |
Mammal urinary |
- |
| 3,8-dihydroxy-3,7-dimethyl-6-octenolc acid |
- |
Mammal urinary |
- |
| 3,9-dihydroxy-3,7-dimethyl-6-octenolc acid |
- |
Mammal urinary |
- |
| E/Z-3,7-dimethyl-2,6-octadienedioic acid |
- |
Mammal urinary |
- |
| 3,7-dimethyl-6-octenedioic acid |
- |
Mammal urinary |
- |
| E-3,7-dimethyl-2,6-octadienoic acid |
- |
Mammal urinary |
- |
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
> 1440 |
Mouse |
Moderate |
|
|
200 |
Rat NOAEL |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
- |
- |
- |
|
|
- |
|
|
|
|
|
|
|
> 4.1 |
Oryzias latipes |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
| Regulatory Threshold Levels (RTLs) |
|
Note: These RTLs have been calculated using the regulatory approach used in the European Union and based on ecotoxocity values in the PPDB.
|
|
|
|
|
|
40 |
Worst case of acute and chronic mammals |
|
|
No data |
No data for acute and chronic birds |
|
|
No data |
No data for acute and chronic earthworms |
|
|
No data |
No data for non-target plants vegetative vigour and seedling emergence |
|
|
No data |
No data for contact and oral honeybees |
|
|
No data |
No data for parasitic wasps and predatory mites |
|
|
0.041 |
Worst case of temperate acute and chronic fish |
|
|
No data |
No data for temperate acute and chronic aquatic invertebrates |
|
|
No data |
No data for free-floating plants, rooted plants, acute and chronic algae |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
|
- |
- |
- |
|
|
> 1440 |
Mouse |
Moderate |
|
|
200 |
Rat NOAEL |
Low |
|
|
- |
- |
- |
|
|
> 1000 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Rabbit |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
Elimination is rapid and via urine as metabolites, with approximately 50% of the dose excreted within 24 hr |
|
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
XNo, known not to cause a problem |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
?Possibly, status not identified |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
| No data found |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
| Eye irritant |
Phototoxicant |
  |
✓Yes, known to cause a problem |
No data found |
  |
|
|
|
May cause dermatitis High doses may cause liver injury, body weight changes, upper respiratory irritation, eye damage, somnolence, and kidney effects. |
|
|
|
|
|
Incompatible with alkalies and strong acid Auto-ignition temperature: 225 DegC When heated to decomposition it emits acrid smoke and irritating fumes Combustible - above 82 DegC explosive vapour/air mixtures may be formed |
|
|
Health: H315, H317 |
|
|
- |
|
|
UN2810 |
|
|
- |
|
|
- |
|
|
|
|
|
citral |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
| Record last updated: |
21/02/2026 |
| Contact: |
aeru@herts.ac.uk |
| Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |
© Copyright University of Hertfordshire, 2006-2026. All Rights Reserved
Your use of this website and its various databases is subject to the terms detailed in the University of Hertfordshire’s copyright and IPR statement that can be found at
https://www.herts.ac.uk/about-us/legal.
In addition, your use of this website and its various databases is subject to the terms of this additional Copyright Statement and the database
Conditions of use document.
Unless explicitly stated otherwise, the content of this website and databases are owned and controlled by the University of Hertfordshire. Site content, including its selection and arrangement, is owned by the University of Hertfordshire and is protected by copyright and other laws.
Except as otherwise expressly permitted under copyright law or within the database Conditions of Use document, the content of this site may not be copied, reproduced, republished, downloaded, posted, broadcast or transmitted in any way without first obtaining the University of Hertfordshire’s written permission.
By using our databases the user is deemed to have agreed to comply with all of the terms and conditions as described above and within all relevant documentation.