Endosulfan sulfate |

Last updated: 23/02/2024
|
 |
(Also known as: thiodan sulfate) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
|
|
|
Chemical transformation product |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
Not applicable |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
No |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
- |
|
C₉H₆Cl₆O₄S |
|
C1C2C(COS(=O)(=O)O1)C3(C(=C(C2(C3(Cl)Cl)Cl)Cl)Cl)Cl |
|
No data |
|
AAPVQEMYVNZIOO-UHFFFAOYSA-N |
|
InChI=1S/C9H6Cl6O4S/c10-5-6(11)8(13)4-2-19-20(16,17)18-1-3(4)7(5,12)9(8,14)15/h3-4H,1-2H2 |
|
Yes |
Cambridge Crystallographic Data Centre diagrams |
|
|
Common Name |
Relationship |
Link |
endosulfan sulfate |
- |
 |
|
Metabolite |
|
Soil |
|
Unclassified substance |
|
- |
|
- |
|
Synthetic |
|
Not applicable |
|
1031-07-8 |
|
- |
|
- |
|
Not applicable |
|
- |
|
602-052-00-5 |
|
422.92 |
|
- |
|
- |
|
6,7,8,9,10-hexachloro-1,5,5a,6,9,9a-hexahydro-6,9-methano-2,4,3-benzodioxathiepin-3,3-dioxide |
|
Chemical subject to PIC regulations |
|
- |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
- |
|
- |
|
|
|
|
|
0.48 |
at 25 °C |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
4.57 X 1003 |
Calculated |
- |
|
3.66 |
|
High |
|
|
Soluble |
|
- |
|
Regulatory data - observed in metabolism and farm animal feeding studies |
|
- |
|
1.94 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
- |
|
- |
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
4.0 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
Published literature RL₅₀ range 3.9-4.0 days, 2 field grown crops, various matrices, n=2 |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
Non-mobile |
|
5194 |
|
Estimated |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
|
|
|
|
|
- |
- |
- |
|
|
Cannot be calculated |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
18 |
Rat |
High |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
0.01 |
Cyprinidae spp. 48 hr |
High |
|
- |
- |
- |
|
- |
- |
- |
|
0.76 |
Daphnia magna |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
0.1 |
Chironomus riparius 2 day |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
18 |
Rat |
High |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
No data found |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
No data found |
No data found |
No data found |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
No data found |
No data found |
No data found |
Eye irritant |
Phototoxicant |
|
No data found |
No data found |
|
|
|
No further information available |
|
|
|
No information available |
|
- |
|
Not listed (Not listed) |
|
- |
|
- |
|
- |
|
|
|
endosulfan sulfate |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
siarczan endosulfanu |
|
- |
|
- |
|
- |
|
- |
Record last updated: |
23/02/2024 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |