| Orange oil |

Last updated: 18/03/2026
|
 |
(Also known as: D-limonene; orange essential oil) |
The following Pesticide Hazard Tricolour (PHT) alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement. The alerts for Highly Hazardous Pesticides (HHPs) are based on applying the FAO/WHO (Type 1) and the PAN (Type II) criteria to PPDB data. Further details on the HHP indicators are given in the tables below. Neither the PHT nor the HHP hazard alerts take account of usage patterns or exposure, thus they do not represent risk.
| PHT: Environmental fate |
PHT: Ecotoxicity |
PHT: Human health |
Highly Hazardous Pesticide |
|   |
|
|
  |
|
|
An insect repellant with a strong citrus smell used alone or in combination with other insecticides |
|
|
Fleas; Ticks; Mosquito larvae |
|
|
Animals; Humans |
|
|
- |
|
|
- |
|
|
Class: Magnoliopsida; Order: Sapindales; Family: Rutaceae |
|
|
Approved |
|
|
31/07/2029 |
|
|
No UK approval for use as a plant protection agent |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Approved |
|
|
France/Czech Republic |
|
|
31/12/2026 |
|
|
No |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| ✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
  |
  |
✓ |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| ✓ |
  |
✓ |
✓ |
  |
  |
✓ |
  |
✓ |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|   |
  |
✓ |
✓ |
✓ |
✓ |
✓ |
  |
  |
|
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
|   |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
|
d-limonene, the main constituent of orange oil, is one of two optical isomers of limonene, due to a chiral centre at the carbon adjacent to the double bond in its ring structure. This chirality gives rise to enantiomeric isomerism forming d-limonene (R-limonene) and l-limonene (S-limonene). These enantiomers vary in biological activity, with d-limonene more commonly used in pest control. |
|
|
- |
|
|
Major constituent: C=C(\C1C/C=C(/C)CC1)C |
|
|
- |
|
|
- |
|
|
Major constituent: InChI=1S/C10H16/c1-8(2)10-6-4-9(3)5-7-10/h4,10H,1,5-7H2,2-3H3 |
|
|
No |
|
|
Insecticide; Repellent; Adjuvant; Veterinary substance |
|
|
Plant-derived substance; Plant oil |
|
|
- |
|
|
- |
|
|
Natural; Complex mixture |
|
|
Odourous repellent |
|
|
Orange peel oil is sourced from the rind of oranges, specifically from the oil glands located in the outer layer of the peel. |
|
|
Orange oil is compositionally consistent being dominated by a single monoterpene: d limonene (85-95%). The remainder consists of oxygenated terpenes, aldehydes, and trace phenolics that give the oil its characteristic aroma and functional properties. |
|
|
Public health applications |
|
|
- |
|
|
8028-48-6 |
|
|
232-433-8 |
|
|
None allocated |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
Major consitutent: (R)-4-isopropenyl-1-methylcyclohexene |
|
|
Major consitituent: (4R)-1-methyl-4-(1-methylethenyl)cyclohexene |
|
|
| UK Poisons List Order 1972 |
Rotterdam Convention |
Montreal Protocol |
|
|
|
| Stockholm Convention |
OSPAR |
EU Water Framework Directive |
|
|
|
|
|
|
- |
|
|
- |
|
|
|
- |
|
|
- |
|
|
FEMA=2825-2826; FLAVIS=04.073 |
|
|
Not applicable |
|
|
Not applicable |
|
|
UNE |
|
|
Not applicable |
|
|
- |
|
|
Yellow oily liquid with citrus odour comprised of a complex and variable mixture of d-limonene (~95%) plus alpha-pinene, sabinene, myrcene, linalool, citronellal, neral and geranial. |
|
|
|
|
|
|
|
|
Current |
|
|
2014, registered USA |
|
|
- Growing Success Organics Ltd
- Oro Agri Inc
- USA
- Rovensa Next[ BASF Speciality Chemicals
|
|
|
- XT-2000 Orange Oil Plus
- Rovensa Orange Oil Biocide
|
|
|
Usually suppled as ready-to-use formulations such as sprays and as emulsifiable concentrates, granules and impregnated collars |
|
|
Commercial production of orange oil primarily involves extracting the essential oil from the peel of Citrus sinensis, often as a by-product of orange juice manufacturing. The most common method is cold-pressing, where the oil is separated from the juice through centrifugation. Advanced extraction techniques such as steam distillation, microwave-assisted extraction, and supercritical fluid extraction are also being explored to improve yield and sustainability, especially by valorising orange peel waste. |
|
|
Data for specific plant oils is scarce. However, from publicly available data the carbon footprint of plant oils has been estimated at between 1.0 and 4.0 kg CO₂e per kg of oil. This depends on the plant oil content, agricultural practices and processing methods used. |
|
|
|
|
|
|
|
|
|
|
13.8 |
at 25 °C |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
176 |
|
- |
|
|
- |
- |
- |
|
|
443 |
|
- |
|
|
|
2.00 X 1005 |
Calculated |
- |
|
|
5.3 |
|
High |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
- |
|
|
- |
- |
- |
| - |
|
|
160000 |
|
Highly volatile. If applied directly to plants or soil, drift is a concern & mitigation is advisable |
|
|
1580 |
|
Volatile |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
|
- |
| Soil adsorption and mobility |
|
| Known groundwater metabolites |
|
None
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
> 5000 |
Rat as limonene |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 1405 |
Colinus virginianus |
- |
|
|
- |
- |
- |
|
|
999.7 |
as product corr |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
> 100 |
as product |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
- |
- |
- |
|
|
- |
|
|
|
|
|
|
|
0.702 |
Pimephales promelas |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.421 |
Daphnia magna |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
4.08 |
Desmodesmus subspicatus |
Moderate |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
| Regulatory Threshold Levels (RTLs) |
|
Note: These RTLs have been calculated using the regulatory approach used in the European Union and based on ecotoxocity values in the PPDB.
|
|
|
|
|
|
500 |
Worst case of acute and chronic mammals |
|
|
No data |
No data for acute and chronic birds |
|
|
99.97 |
Worst case of acute and chronic earthworms |
|
|
No data |
No data for non-target plants vegetative vigour and seedling emergence |
|
|
2 |
Worst case of contact and oral honeybees |
|
|
No data |
No data for parasitic wasps and predatory mites |
|
|
0.00702 |
Worst case of temperate acute and chronic fish |
|
|
0.00421 |
Worst case of temperate acute and chronic aquatic invertebrates |
|
|
0.408 |
Worst case of free-floating plants, rooted plants, acute and chronic algae |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
|
Low (class I) |
- |
- |
|
|
> 5000 |
Rat as limonene |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 2000 |
Rat |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
None allocated |
|
- |
|
|
None allocated |
|
- |
|
|
- |
- |
- |
|
|
None allocated |
|
- |
|
|
85 |
|
- |
|
|
- |
- |
- |
|
|
|
Acceptable for proposed uses |
|
|
Acceptable for proposed uses |
|
|
Rapidly excreted (2-3 days) majority in urine & less than 10% in faeces |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B3 B = DNA damage/repair (EFSA database) 3 = Negative ; C3 C = Gene mutation (EFSA database) 3 = Negative ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
XNo, known not to cause a problem |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
?Possibly, status not identified |
XNo, known not to cause a problem |
No data found |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
?Possibly, status not identified |
✓Yes, known to cause a problem |
?Possibly, status not identified |
| Eye irritant |
Phototoxicant |
  |
✓Yes, known to cause a problem |
No data found |
  |
|
|
|
Major consitituent may be a skin sensitiser |
|
|
|
|
|
Flammable Not explosive or oxidising |
|
|
Health: H317; H315l H319 |
|
|
Not listed |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
orange oil |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
| Record last updated: |
18/03/2026 |
| Contact: |
aeru@herts.ac.uk |
| Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |
© Copyright University of Hertfordshire, 2006-2026. All Rights Reserved
Your use of this website and its various databases is subject to the terms detailed in the University of Hertfordshire’s copyright and IPR statement that can be found at
https://www.herts.ac.uk/about-us/legal.
In addition, your use of this website and its various databases is subject to the terms of this additional Copyright Statement and the database
Conditions of use document.
Unless explicitly stated otherwise, the content of this website and databases are owned and controlled by the University of Hertfordshire. Site content, including its selection and arrangement, is owned by the University of Hertfordshire and is protected by copyright and other laws.
Except as otherwise expressly permitted under copyright law or within the database Conditions of Use document, the content of this site may not be copied, reproduced, republished, downloaded, posted, broadcast or transmitted in any way without first obtaining the University of Hertfordshire’s written permission.
By using our databases the user is deemed to have agreed to comply with all of the terms and conditions as described above and within all relevant documentation.