| D-carvone |

Last updated: 24/08/2025
|
 |
(Also known as: p-mentha-6,8-dien-2-one; S-carvone; spearment oil component; (+)-carvone) |
The following Pesticide Hazard Tricolour (PHT) alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement. The alerts for Highly Hazardous Pesticides (HHPs) are based on applying the FAO/WHO (Type 1) and the PAN (Type II) criteria to PPDB data. Further details on the HHP indicators are given in the tables below. Neither the PHT nor the HHP hazard alerts take account of usage patterns or exposure, thus they do not represent risk.
| PHT: Environmental fate |
PHT: Ecotoxicity |
PHT: Human health |
Highly Hazardous Pesticide |
|   |
|
|
  |
|
|
A fungicide and plant growth regulator often used as a potato sprouting inhibitor |
|
|
Sprout growth |
|
|
Seed potatoes |
|
|
Authorised for use and widely used for over 10 years |
|
|
- |
|
|
- |
|
|
Approved (as carvone) |
|
|
31/07/2034 |
|
|
No UK approval for use as a plant protection agent |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Approved |
|
|
Netherlands/Sweden |
|
|
31/07/2034 |
|
|
No |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|   |
  |
✓ |
  |
  |
  |
  |
  |
  |
|
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
|   |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
|
D-carvone is the S-isomer of chiral carvone |
|
|
C₁₀H₁₄O |
|
|
CC1=CCC(CC1=O)C(=C)C |
|
|
CC1=CC[C@H](CC1=O)C(=C)C |
|
|
ULDHMXUKGWMISQ-SECBINFHSA-N |
|
|
InChI=1S/C10H14O/c1-7(2)9-5-4-8(3)10(11)6-9/h4,9H,1,5-6H2,2-3H3/t9-/m1/s1 |
|
|
Yes |
| Cambridge Crystallographic Data Centre diagrams |
|
|
| Common Name |
Relationship |
Link |
| D-carvone |
- |
 |
|
|
Plant Growth Regulator; Metabolite |
|
|
Soil; Groundwater |
|
|
Plant-derived substance |
|
|
>930g kg⁻¹ |
|
|
- |
|
|
Natural |
|
|
Inhibits cell growth |
|
|
Carvone is found naturally in many essential oils including spearmint (Mentha spicata) and can also be found in caraway and dill seeds |
|
|
Post harvest management |
|
|
- |
|
|
2244-16-8 |
|
|
218-827-9 |
|
|
602 |
|
|
- |
|
|
- |
|
|
150.21 |
|
|
- |
|
|
(S)-5-isopropenyl-2-methylcyclohex-2-en-1-one |
|
|
(S)-2-Methyl-5-(1-methylvinyl)cyclohex-2-en-1-one |
|
|
| UK Poisons List Order 1972 |
Rotterdam Convention |
Montreal Protocol |
|
|
|
| Stockholm Convention |
OSPAR |
EU Water Framework Directive |
|
|
|
|
|
|
- |
|
|
- |
|
|
|
- |
|
|
- |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
- |
|
|
Colourless to pale yellow liquid |
|
|
|
|
|
|
|
|
Current |
|
|
- |
|
|
|
|
|
- Talent
- Xeda Bio
- Xeda HM Nat
|
|
|
Usually supplied in formulations for hot or cold fogging for indoor use only |
|
|
Produced commercially by extraction and purification of essential oils such as caraway, dill and spearmint seeds or by chemical syntheisis |
|
|
- |
|
|
|
|
|
|
|
27 |
|
Moderate |
|
|
250000 |
Xylene |
- |
| 250000 |
Heptane |
- |
| 25000 |
Ethyl acetate |
- |
| 250000 |
Acetone |
- |
|
|
-43 |
Freezing point |
- |
|
|
233 |
as Carvone |
- |
|
|
- |
- |
- |
|
|
98 |
as Carvone |
- |
|
|
|
2.51 X 1002 |
Calculated |
- |
|
|
2.4 |
|
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.957 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
| - |
|
|
1900 |
as Carvone |
Highly volatile. If applied directly to plants or soil, drift is a concern & mitigation is advisable |
|
|
3.6 |
as Carvone |
Moderately volatile |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
57.2 |
|
- |
|
|
|
|
|
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
|
- |
| Soil adsorption and mobility |
|
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
> 2000 |
Rat as Carvone |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 1000 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Expert judgement |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
100 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Expert judgement |
Moderate |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
- |
- |
- |
|
|
- |
|
|
|
|
|
|
|
> 20.3 |
Oncorhynchus mykiss |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 9.59 |
Daphnia magna |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
34.3 |
Raphidocelis subcapitata as Carvone |
Low |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
| Regulatory Threshold Levels (RTLs) |
|
Note: These RTLs have been calculated using the regulatory approach used in the European Union and based on ecotoxocity values in the PPDB.
|
|
|
|
|
|
200 |
Worst case of acute and chronic mammals |
|
|
No data |
No data for acute and chronic birds |
|
|
100 |
Worst case of acute and chronic earthworms |
|
|
No data |
No data for non-target plants vegetative vigour and seedling emergence |
|
|
No data |
No data for contact and oral honeybees |
|
|
No data |
No data for parasitic wasps and predatory mites |
|
|
0.203 |
Worst case of temperate acute and chronic fish |
|
|
0.0959 |
Worst case of temperate acute and chronic aquatic invertebrates |
|
|
3.43 |
Worst case of free-floating plants, rooted plants, acute and chronic algae |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
|
Intermediate (class II) |
- |
- |
|
|
> 2000 |
Rat as Carvone |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 4000 |
Rat as Carvone |
- |
|
|
> 5.66 |
Rat 4 hr as Carvone |
- |
|
|
- |
- |
- |
|
|
0.025 |
|
- |
|
|
None allocated |
|
- |
|
|
- |
- |
- |
|
|
0.025 |
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
PPE/PPC recommended |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
XNo, known not to cause a problem |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
?Possibly, status not identified |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
?Possibly, status not identified |
✓Yes, known to cause a problem |
| Eye irritant |
Phototoxicant |
  |
?Possibly, status not identified |
XNo, known not to cause a problem |
  |
|
|
|
May cause gastrointestinal tract irritation with nausea, vomiting and diarrhoea Skin sensitiser Possible kidney toxicant |
|
|
|
|
|
Not explosive or oxidising Flammable |
|
|
Health: H304, H317, H315 |
|
|
Not listed |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
D-carvone |
|
|
d-carvone |
|
|
d-Carvon |
|
|
d-carvon |
|
|
d-carvone |
|
|
d-carvone |
|
|
- |
|
|
d-karwon |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
| Record last updated: |
24/08/2025 |
| Contact: |
aeru@herts.ac.uk |
| Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |
© Copyright University of Hertfordshire, 2006-2026. All Rights Reserved
Your use of this website and its various databases is subject to the terms detailed in the University of Hertfordshire’s copyright and IPR statement that can be found at
https://www.herts.ac.uk/about-us/legal.
In addition, your use of this website and its various databases is subject to the terms of this additional Copyright Statement and the database
Conditions of use document.
Unless explicitly stated otherwise, the content of this website and databases are owned and controlled by the University of Hertfordshire. Site content, including its selection and arrangement, is owned by the University of Hertfordshire and is protected by copyright and other laws.
Except as otherwise expressly permitted under copyright law or within the database Conditions of Use document, the content of this site may not be copied, reproduced, republished, downloaded, posted, broadcast or transmitted in any way without first obtaining the University of Hertfordshire’s written permission.
By using our databases the user is deemed to have agreed to comply with all of the terms and conditions as described above and within all relevant documentation.