| Alpha-terpinene |

Last updated: 25/10/2025
|
 |
(Also known as: Tea tree oil extract; Oil of Melaleuca; TTO; terpilene) |
The following Pesticide Hazard Tricolour (PHT) alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement. The alerts for Highly Hazardous Pesticides (HHPs) are based on applying the FAO/WHO (Type 1) and the PAN (Type II) criteria to PPDB data. Further details on the HHP indicators are given in the tables below. Neither the PHT nor the HHP hazard alerts take account of usage patterns or exposure, thus they do not represent risk.
| PHT: Environmental fate |
PHT: Ecotoxicity |
PHT: Human health |
Highly Hazardous Pesticide |
|
  |
|
  |
|
|
A component tea tree oil, thyme oil and other essential oils and is used to control various fungal pathogens on a wide range of crops |
|
|
Various fungal pathogens including powdery mildew and early blight |
|
|
Potatoes; Carrots; Tomatoes; Cucumbers; Fruit; Ornamentals |
|
|
- |
|
|
- |
|
|
- |
|
|
Not approved |
|
|
Not applicable |
|
|
No UK approval for use as a plant protection agent |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Approved (as Tea tree oil) |
|
|
Poland/Bulgaria |
|
|
31/01/2026 |
|
|
No |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| ✓ |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
|   |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
|
Alpha-terpinene exhibits structural isomerism, specifically positional isomerism, within the family of terpinene isomers, namely gamma-terpinene, beta-terpinene, and delta-terpinene which all differs in the position of the carbon–carbon double bonds within the cyclohexadiene ring. In alpha-terpinene, the double bonds are located at the 1,3-positions, forming a 1,3-cyclohexadiene system, whereas in gamma-terpinene, for example, they occupy the 1,4-positions. |
|
|
C₁₀H₁₆ |
|
|
CC1=CC=C(CC1)C(C)C |
|
|
No data |
|
|
YHQGMYUVUMAZJR-UHFFFAOYSA-N |
|
|
InChI=1S/C10H16/c1-8(2)10-6-4-9(3)5-7-10/h4,6,8H,5,7H2,1-3H3 |
|
|
Yes |
|
|
Fungicide |
|
|
Plant-derived substance |
|
|
50 g kg⁻¹ |
|
|
- |
|
|
Natural |
|
|
Tea tree oil appears to disrupt the permeability barrier of microbial cell membrane structures, causing loss of chemiosmotic control. |
|
|
Alpha-terpinene was identified as a component of various essential oils, such as cardamom, tea-tree and marjoram oils in the 19th century |
|
|
Crop protection |
|
|
Powdery mildew; Early blight |
|
|
Potatoes; Carrots; Tomatoes; Cucumbers; Fruit; Ornamentals |
|
|
Tea tree oil is suitable for use in all farming systems where approved for use in that country |
|
|
99-86-5 |
|
|
202-795-1 |
|
|
- |
|
|
- |
|
|
- |
|
|
138.25 |
|
|
- |
|
|
1-methyl-4-isopropyl-1,3-cyclohexadiene |
|
|
α-terpinene |
|
|
| UK Poisons List Order 1972 |
Rotterdam Convention |
Montreal Protocol |
|
|
|
| Stockholm Convention |
OSPAR |
EU Water Framework Directive |
|
|
|
|
|
|
- |
|
|
- |
|
|
|
- |
|
|
- |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
BM01 |
|
|
- |
|
|
Clear liquid |
|
|
|
|
|
|
|
|
Current |
|
|
1920s, Tea tree oil first reported |
|
|
|
|
|
|
|
|
Tea tree oil is usually supplied as an emulsifable concentrate that is diluted and used as a foliar spray |
|
|
Alpha-terpinene is produced commercially via extraction from natural sources and chemical synthesis. Steam Distillation is the most common method used to extract alpha-terpinene from essential oils like tea tree oil (Melaleuca alternifolia). The plant material is subjected to steam, which vaporises the alpha-terpinene. The vapour is then condensed and collected. Alternatively, alpha-terpinene can be produced by metabolically engineered microorganisms, such as Escherichia coli and by a fermentation process. |
|
|
- |
|
|
|
|
|
|
|
5.92 |
|
Low |
|
|
- |
- |
- |
|
|
-31.1 |
|
- |
|
|
173 |
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
5.62 X 1004 |
Calculated |
- |
|
|
4.75 |
|
High |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Not applicable |
|
- |
| No dissociation |
|
|
106400 |
|
Highly volatile. If applied directly to plants or soil, drift is a concern & mitigation is advisable |
|
|
2485 |
|
Volatile |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
|
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
|
Slightly mobile |
|
|
1324 |
|
|
EU dossier - estimated |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
1680 |
Rat |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
- |
- |
- |
|
|
- |
|
|
|
|
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
| Regulatory Threshold Levels (RTLs) |
|
Note: These RTLs have been calculated using the regulatory approach used in the European Union and based on ecotoxocity values in the PPDB.
|
|
|
|
|
|
168 |
Worst case of acute and chronic mammals |
|
|
No data |
No data for acute and chronic birds |
|
|
No data |
No data for acute and chronic earthworms |
|
|
No data |
No data for non-target plants vegetative vigour and seedling emergence |
|
|
No data |
No data for contact and oral honeybees |
|
|
No data |
No data for parasitic wasps and predatory mites |
|
|
No data |
No data for temperate acute and chronic fish |
|
|
No data |
No data for temperate acute and chronic aquatic invertebrates |
|
|
No data |
No data for free-floating plants, rooted plants, acute and chronic algae |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
|
Low (class I) |
- |
- |
|
|
1680 |
Rat |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
| No data found |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
✓Yes, known to cause a problem |
No data found |
No data found |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
?Possibly, status not identified |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
| Eye irritant |
Phototoxicant |
  |
✓Yes, known to cause a problem |
No data found |
  |
|
|
|
No further information |
|
|
|
|
|
Not explosive or oxidising |
|
|
Health: H302, H317, H319, H335 Handling: H226 Environment: H411 |
|
|
Not listed (Not listed) |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
alpha-terpinene |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
| Record last updated: |
25/10/2025 |
| Contact: |
aeru@herts.ac.uk |
| Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |
© Copyright University of Hertfordshire, 2006-2026. All Rights Reserved
Your use of this website and its various databases is subject to the terms detailed in the University of Hertfordshire’s copyright and IPR statement that can be found at
https://www.herts.ac.uk/about-us/legal.
In addition, your use of this website and its various databases is subject to the terms of this additional Copyright Statement and the database
Conditions of use document.
Unless explicitly stated otherwise, the content of this website and databases are owned and controlled by the University of Hertfordshire. Site content, including its selection and arrangement, is owned by the University of Hertfordshire and is protected by copyright and other laws.
Except as otherwise expressly permitted under copyright law or within the database Conditions of Use document, the content of this site may not be copied, reproduced, republished, downloaded, posted, broadcast or transmitted in any way without first obtaining the University of Hertfordshire’s written permission.
By using our databases the user is deemed to have agreed to comply with all of the terms and conditions as described above and within all relevant documentation.