Para-cymene |

Last updated: 17/09/2025
|
 |
(Also known as: Tea tree oil extract; Oil of Melaleuca; TTO; Camphogen; p-cymene) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement. These hazard alerts do not take account of usage patterns or exposure, thus do not represent risk.
Environmental fate |
Ecotoxicity |
Human health |
|
|
|
|
A component of various essential oils including cumin oil (12-25%) and tea tree oil (0.5-8%) which is used to control various fungal pathogens on a wide range of crops |
|
Various fungal pathogens including powdery mildew and early blight |
|
Potatoes; Carrots; Tomatoes; Cucumbers; Fruit; Ornamentals |
|
- |
|
- |
|
- |
|
Not approved |
|
Not applicable |
|
No UK approval for use as a plant protection agent |
EC Regulation 1107/2009 (repealing 91/414) |
|
Approved (as Tea tree oil) |
|
Poland/Bulgaria |
|
31/01/2026 |
|
No |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
  |
  |
  |
  |
  |
  |
  |
  |
  |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
  |
  |
  |
  |
  |
  |
  |
  |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
✓ |
  |
  |
✓ |
  |
  |
  |
  |
  |
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
  |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
Para-cymene (p-cymene) exhibits positional isomerism, a type of structural isomerism where the position of substituents on the aromatic ring varies. It consists of a benzene ring substituted with a methyl group and an isopropyl group in the para position, meaning they are located opposite each other on the ring. In addition to p-cymene, there are two other isomers: ortho-cymene, where the substituents are adjacent, and meta-cymene, where they are separated by one carbon atom. Para-cymene is the most naturally occurring isomer. |
|
C₁₀H₁₄ |
|
CC1=CC=C(C=C1)C(C)C |
|
No data |
|
HFPZCAJZSCWRBC-UHFFFAOYSA-N |
|
InChI=1S/C10H14/c1-8(2)10-6-4-9(3)5-7-10/h4-8H,1-3H3 |
|
Yes |
|
Fungicide |
|
Plant-derived substance |
|
- |
|
- |
|
Natural |
|
Tea tree oil appears to disrupt the permeability barrier of microbial cell membrane structures, causing loss of chemiosmotic control. |
|
Para-cymene was identified as a component of various essential oils, such as tea tree oil and cumin oil in the late 19th Century. |
|
Crop protection |
|
Various fungal pathogens including powdery mildew and early blight |
|
Potatoes; Carrots; Tomatoes; Cucumbers; Fruit; Ornamentals |
|
Tea tree oil is suitable for use in all farming systems where approved for use in that country |
|
99-87-6 |
|
202-796-7 |
|
- |
|
- |
|
- |
|
134.22 |
|
- |
|
1-methyl-4-isopropylbenzene |
|
para-cymene |
|
- |
|
- |
|
- |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
- |
|
Clear liquid |
|
|
|
|
|
Current |
|
1920s, Tea tree oil first reported |
|
|
|
|
|
Tea tree oil is usually supplied as an emulsifable concentrate that is diluted and used as a foliar spray |
|
Para-cymene is commonly extracted from essential oils like cumin oil, tea-tree oil and thyme oil. The plant material is subjected to steam, which vaporises the para-cymene. The vapour is then condensed and collected. Fractional distillation or solvent extraction may also be used to separate para-cymene from other components in the essential oil. Para-cymene can be synthesised by alkylating toluene with propene in the presence of a catalyst. |
|
Data for specific plant oils is scarce. However, from publicly available data the carbon footprint of plant oils has been estimated at between 1.0 and 4.0 kg CO₂e per kg of oil. This depends on the plant oil content, agricultural practices and processing methods used. |
|
|
|
|
|
|
|
23.4 |
|
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
177 |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
2.75 X 1004 |
Calculated |
- |
|
4.44 |
|
High |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Not applicable |
|
- |
No dissociation |
|
1.94 X 1005 |
|
Highly volatile. If applied directly to plants or soil, drift is a concern & mitigation is advisable |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
- |
Non-mobile |
|
4732 |
|
EU dossier - estimated |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
4750 |
Rat |
Low |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
> 1000 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Expert judgement |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
> 100 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Expert judgement |
Low |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
48.0 |
Cyprinodon variegatus marine species |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
6.5 |
Daphnia magna |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
Low (class I) |
- |
- |
|
4750 |
Rat |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
No data found |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
No data found |
No data found |
No data found |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
?Possibly, status not identified |
✓Yes, known to cause a problem |
XNo, known not to cause a problem |
Eye irritant |
Phototoxicant |
  |
✓Yes, known to cause a problem |
No data found |
  |
|
|
No adverse health issues noted |
|
|
|
Not explosive or oxidising Flammable IMDG Transport Hazard Class 3 |
|
Health: H304, H315, H319, H335 Handling: H226 Environment: H411 |
|
Not listed (Not listed) |
|
UN2046 |
|
- |
|
- |
|
|
|
para-cymene |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
Record last updated: |
17/09/2025 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |