Terpinolene |

Last updated: 25/08/2025
|
 |
(Also known as: Tea tree oil extract; Oil of Melaleuca; TTO; Isoterpinene; Tereben; alpha-terpinolene) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement. These hazard alerts do not take account of usage patterns or exposure, thus do not represent risk.
Environmental fate |
Ecotoxicity |
Human health |
|
|
|
|
A minor component of various essential oils including marjoram oil (1-2%) and tea tree oil (1-5%) and which is used to control various fungal pathogens on a wide range of crops. Also used as an insect repellent. |
|
Various fungal pathogens including powdery mildew and early blight |
|
Potatoes; Carrots; Tomatoes; Cucumbers; Fruit; Ornamentals |
|
- |
|
- |
|
- |
|
Not approved |
|
Not applicable |
|
Not applicable |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Not applicable |
|
No |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
  |
  |
  |
  |
  |
  |
  |
  |
  |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
  |
  |
  |
  |
  |
  |
  |
  |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
  |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
  |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
Terpinolene exists as alpha-terpinolene and beta-terpinolene. Alpha-terpinolene is the most common isomer and a key component of many essential oils. |
|
C₁₀H₁₆ |
|
CC1=CCC(=C(C)C)CC1 |
|
- |
|
MOYAFQVGZZPNRA-UHFFFAOYSA-N |
|
InChI=1S/C10H16/c1-8(2)10-6-4-9(3)5-7-10/h4H,5-7H2,1-3H3 |
|
Yes |
|
Fungicide; Insecticide |
|
Plant-derived substance |
|
- |
|
- |
|
Natural |
|
Tea tree oil appears to disrupt the permeability barrier of microbial cell membrane structures, causing loss of chemiosmotic control. Odour acts as an insect repellent. |
|
Alpha-terpinoline, the most common form, was identified as a component of various essential oils, such as tea tree oil and marjoram oil in the late 19th century. |
|
Crop protection |
|
Various fungal pathogens including powdery mildew and early blight |
|
Potatoes; Carrots; Tomatoes; Cucumbers; Fruit; Ornamentals |
|
Tea tree oil is suitable for use in all farming systems where approved for use in that country |
|
586-62-9 |
|
69073-38-7 |
|
209-578-0 |
|
- |
|
- |
|
11463 |
|
136.23 |
|
- |
|
1-methyl-4-propan-2-ylidenecyclohexene |
|
p-mentha-1,4(8)-diene |
|
- |
|
- |
|
FLAVIS=01.005 |
|
- |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
- |
|
Clear to straw coloured liquid with a pine-like odour |
|
|
|
|
|
Current |
|
1920s, Tea tree oil first reported |
|
|
|
|
|
Tea tree oil is usually supplied as an emulsifable concentrate that is diluted and used as a foliar spray |
|
Alpha-terpinoline is produced commercially via extraction from natural sources and chemical synthesis. Steam Distillation is the most common method used to extract alpha-terpinoline from essential oils like tea tree oil ( Melaleuca alternifolia). The plant material is subjected to steam, which vaporises the alpha-terpinoline. The vapour is then condensed and collected. Alternatively, fractional distillation or solvent extraction can be used to separate alpha-terpinoline from other components in the essential oil. Alpha-terpinoline can be synthesised from terpinene through a series of chemical reactions, including oxidation and hydrolysis. |
|
- |
|
|
|
|
|
|
|
9.5 |
|
Low |
|
- |
- |
- |
|
<25 |
|
- |
|
186 |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
7.59 X 1004 |
Calculated |
- |
|
4.88 |
as alpha-isomer |
High |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Not applicable |
|
- |
No dissociation |
|
99042 |
|
Highly volatile. If applied directly to plants or soil, drift is a concern & mitigation is advisable |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
|
Slightly mobile |
|
2632 |
|
EU dossier - estimated for alpha-isomer |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
4390 |
Rat |
Low |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
> 1000 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Expert judgement |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
> 100 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Expert judgement |
Low |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
Low (class I) |
- |
- |
|
4390 |
Rat |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
No data found |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
No data found |
No data found |
No data found |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
No data found |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
Eye irritant |
Phototoxicant |
  |
✓Yes, known to cause a problem |
No data found |
  |
|
|
No further information available |
|
|
|
Not explosive or oxidising Flammable IMDG Transport Hazard Class 3 |
|
Health: H304, H315, H317 Handling: H226 Environment: H410, H411 |
|
Not listed (Not listed) |
|
UN2541 |
|
Packaging Group III (minor danger) |
|
- |
|
|
|
terpinolene |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
Record last updated: |
25/08/2025 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |